| Company Name: |
Shanghai Fuyi Biological Technology Co., Ltd.
|
| Tel: |
18096642264;18096409024 |
| Email: |
sales@foreversyn.com |
| Products Intro: |
Product Name:Orphenadrine Impurity 4/Orphenadrine EP Impurity E/Orphenadrine USP RC E/Orphenadrine meta-Methyl Analog/(RS)-N,N-Dimethyl-2-[(3-methylphenyl)phenylmethoxy]-ethanamine CAS:21945-86-8 Purity:95% HPLC
|
| Company Name: |
Hefei fuya biotechnology co. LTD
|
| Tel: |
18096409024 |
| Email: |
sales02@foreversyn.com |
| Products Intro: |
Product Name:OrphenadrineEPImpurityE CAS:21945-86-8 Purity:95% HPLC Package:25mg;100mg
|
|
| | N,N-dimethyl-2-[(3-methylphenyl)-phenylmethoxy]ethanamine Basic information |
| Product Name: | N,N-dimethyl-2-[(3-methylphenyl)-phenylmethoxy]ethanamine | | Synonyms: | Orphenadrine Impurity 4/Orphenadrine EP Impurity E/Orphenadrine USP RC E/Orphenadrine meta-Methyl Analog/(RS)-N,N-Dimethyl-2-[(3-methylphenyl)phenylmethoxy]-ethanamine;N,N-dimethyl-2-[(3-methylphenyl)-phenylmethoxy]ethanamine;Orphenadrine hydrochloride EP impurity E;Orphenadrine EP Impurity E;Ethanamine, N,N-dimethyl-2-[(3-methylphenyl)phenylmethoxy]-;Orphenadrine Impurity 5 (Orphenadrine EP Impurity E)(Orphenadrine USP RC E);Orphenadrine Related Compound E (50 mg);Orphenadrine citrate USP Impurity E | | CAS: | 21945-86-8 | | MF: | C18H23NO | | MW: | 269.39 | | EINECS: | | | Product Categories: | | | Mol File: | 21945-86-8.mol | ![N,N-dimethyl-2-[(3-methylphenyl)-phenylmethoxy]ethanamine Structure](CAS/20180601/GIF/21945-86-8.gif) |
| | N,N-dimethyl-2-[(3-methylphenyl)-phenylmethoxy]ethanamine Chemical Properties |
| Boiling point | 360.4±32.0 °C(Predicted) | | density | 1.014±0.06 g/cm3(Predicted) | | storage temp. | 2-8°C | | pka | 8.74±0.28(Predicted) | | Major Application | pharmaceutical | | InChI | 1S/C18H23NO/c1-15-8-7-11-17(14-15)18(20-13-12-19(2)3)16-9-5-4-6-10-16/h4-11,14,18H,12-13H2,1-3H3 | | InChIKey | VSIVTUKDXUYWPL-UHFFFAOYSA-N | | SMILES | N(CCOC(c2cc(ccc2)C)c1ccccc1)(C)C |
| WGK Germany | WGK 3 | | HS Code | 2922199695 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Acute Tox. 4 Oral |
| | N,N-dimethyl-2-[(3-methylphenyl)-phenylmethoxy]ethanamine Usage And Synthesis |
| Uses | These Secondary Standards are qualified as Certified Reference Materials. These are suitable for use in several analytical applications including but not limited to pharma release testing, pharma method development for qualitative and quantitative analyses, food and beverage quality control testing, and other calibration requirements. |
| | N,N-dimethyl-2-[(3-methylphenyl)-phenylmethoxy]ethanamine Preparation Products And Raw materials |
|