|
|
| | trans-4-(trans-4-Propylcyclohexyl)cyclohexanol Basic information |
| | trans-4-(trans-4-Propylcyclohexyl)cyclohexanol Chemical Properties |
| Melting point | 124 °C | | Boiling point | 317.6±10.0 °C(Predicted) | | density | 0.944±0.06 g/cm3(Predicted) | | storage temp. | Sealed in dry,Room Temperature | | form | powder to crystal | | pka | 15.29±0.40(Predicted) | | color | White to Light yellow | | InChI | InChI=1S/C15H28O/c1-2-3-12-4-6-13(7-5-12)14-8-10-15(16)11-9-14/h12-16H,2-11H2,1H3/t12-,13-,14-,15- | | InChIKey | DFXWFFHIZJDOFZ-KTSLABGISA-N | | SMILES | [C@@H]1([C@@H]2CC[C@@H](CCC)CC2)CC[C@@H](O)CC1 |
| | trans-4-(trans-4-Propylcyclohexyl)cyclohexanol Usage And Synthesis |
| Chemical Properties | white crystalline | | Uses | Intermediates of Liquid Crystals |
| | trans-4-(trans-4-Propylcyclohexyl)cyclohexanol Preparation Products And Raw materials |
|