| Company Name: |
Energy Chemical |
| Tel: |
400-0056266 |
| Email: |
sales8178@energy-chemical.com |
HIPPURYL-HIS-LEU FREE BASE manufacturers
|
| | HIPPURYL-HIS-LEU FREE BASE Basic information |
| Product Name: | HIPPURYL-HIS-LEU FREE BASE | | Synonyms: | N-Hippuryl-His-Leu hydrate{99%};L-Leucine,N-benzoylglycyl-L-histidyl-, hydrate (9CI);N-Benzoylglycyl-L-histidyl-L-leucine hydrate;N-Benzoyl-Gly-His-Leu hydrate;N-Hippuryl-His-Leu hydD23-Rate;N-Hippuryl-His-Leu hydrate 99%;N-Hippuryl-His-Leu;HIPPURYL-HIS-LEU FREE BASE | | CAS: | 207386-83-2 | | MF: | C21H31N5O5 | | MW: | 433.50134 | | EINECS: | 250-597-9 | | Product Categories: | | | Mol File: | 207386-83-2.mol |  |
| | HIPPURYL-HIS-LEU FREE BASE Chemical Properties |
| Melting point | 108-110 °C (dec.) | | storage temp. | -20°C | | solubility | acetic acid: ~50mg/mL | | form | powder | | color | white to off-white | | Optical Rotation | [α]22/D 41°, c = 1 in 1 M HCl | | BRN | 5664178 | | InChIKey | NWOJMNXIJBZMPK-QJHJCNPRSA-N | | SMILES | [C@@H](NC(=O)CNC(=O)C1C=CC=CC=1)(C(=O)N[C@H](C(=O)O)CC(C)C)CC1N=CNC=1.O |&1:0,17,r| | | CAS DataBase Reference | 207386-83-2 |
| WGK Germany | 3 | | Storage Class | 11 - Combustible Solids |
| | HIPPURYL-HIS-LEU FREE BASE Usage And Synthesis |
| Uses | N-Hippuryl-His-Leu hydrate has been used in the measurement of angiotensin-converting enzyme (ACE) inhibitory activity using oyster hydrolysates, semimembranosus muscle samples, and rabbit lung acetone powder. | | reaction suitability | reaction type: solution phase peptide synthesis | | Biological Activity | N-Hippuryl-His-Leu hydrate (HHL) can be used as an artificial substrate for angiotensin-converting enzyme (ACE). |
| | HIPPURYL-HIS-LEU FREE BASE Preparation Products And Raw materials |
|