| Company Name: |
Energy Chemical |
| Tel: |
400-0056266 |
| Email: |
sales8178@energy-chemical.com |
|
| | Fmoc-N-Me-Aib-OH Basic information |
| Product Name: | Fmoc-N-Me-Aib-OH | | Synonyms: | Fmoc-N,2-dimethylalanine;n-fmoc-α-(methylamino)isobutyric acid;N-Fmoc-α-(methylamino)isobutyric acid, Fmoc-N,2-dimethylalanine;2-[[(9H-Fluoren-9-ylmethoxy)carbonyl](methyl)amino]-2-methylpropanoic acid;N-[(9H-Fluoren-9-ylmethoxy)carbonyl]-N,2-dimethylalanine;N-Fmoc-N,2-dimethyl-DL-alanine;(9H-Fluoren-9-yl)MethOxy]Carbonyl N-Me-Aib-OH;Alanine, N-[(9H-fluoren-9-ylmethoxy)carbonyl]-N,2-dimethyl- | | CAS: | 400779-65-9 | | MF: | C20H21NO4 | | MW: | 339.39 | | EINECS: | | | Product Categories: | | | Mol File: | 400779-65-9.mol |  |
| | Fmoc-N-Me-Aib-OH Chemical Properties |
| Boiling point | 518.1±29.0 °C(Predicted) | | density | 1.239±0.06 g/cm3(Predicted) | | storage temp. | 2-8°C | | pka | 4.05±0.10(Predicted) | | form | solid | | Appearance | White to off-white Solid | | Major Application | peptide synthesis | | InChI | 1S/C20H21NO4/c1-20(2,18(22)23)21(3)19(24)25-12-17-15-10-6-4-8-13(15)14-9-5-7-11-16(14)17/h4-11,17H,12H2,1-3H3,(H,22,23) | | InChIKey | HFPNKXXPYGPHJQ-UHFFFAOYSA-N | | SMILES | CN(C(=O)OCC1c2ccccc2-c3ccccc13)C(C)(C)C(O)=O |
| WGK Germany | 3 | | Storage Class | 11 - Combustible Solids |
| | Fmoc-N-Me-Aib-OH Usage And Synthesis |
| Uses | peptide synthesis | | reaction suitability | reaction type: Fmoc solid-phase peptide synthesis |
| | Fmoc-N-Me-Aib-OH Preparation Products And Raw materials |
|