| Company Name: |
Sigma-Aldrich |
| Tel: |
021-61415566 800-8193336 |
| Email: |
orderCN@merckgroup.com |
|
| | 1-[4-(1H,1H,2H,2H-Perfluorodecyl)phenyl)-1,1-diphenylmethanol Basic information |
| Product Name: | 1-[4-(1H,1H,2H,2H-Perfluorodecyl)phenyl)-1,1-diphenylmethanol | | Synonyms: | 1-[4-(1H,1H,2H,2H-Perfluorodecyl)phenyl)-1,1-diphenylmethanol;F17 Trityl OH, 1-[4-(3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10,10-Heptadecafluordecyl)-phenyl]-1,1-diphenylmethanol;F17 Trityl OH;Benzenemethanol, 4-(3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10,10-heptadecafluorodecyl)-α,α-diphenyl-;1-[4-(1H,1H,2H,2H-Perfluorodecyl)phenyl)-1,1-diphenylmethanol;1-[4-(1H,1H,2H,2H-Perfluorodecyl)phenyl)-1,1-diphenylmethanol, CAS 649561-66-0 | | CAS: | 649561-66-0 | | MF: | C29H19F17O | | MW: | 706.43 | | EINECS: | | | Product Categories: | | | Mol File: | 649561-66-0.mol |  |
| | 1-[4-(1H,1H,2H,2H-Perfluorodecyl)phenyl)-1,1-diphenylmethanol Chemical Properties |
| Melting point | 76-80 °C | | form | solid | | InChIKey | ONXVYKQEANDRAX-UHFFFAOYSA-N | | SMILES | OC(c1ccccc1)(c2ccccc2)c3ccc(CCC(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F)cc3 | | EPA Substance Registry System | [4-(3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10,10-Heptadecafluorodecyl)phenyl](diphenyl)methanol (649561-66-0) |
| Hazard Codes | Xi | | Risk Statements | 38 | | WGK Germany | 3 | | Storage Class | 6.1C - Combustible acute toxic Cat.3 toxic compounds or compounds which causing chronic effects | | Hazard Classifications | Acute Tox. 4 Inhalation Acute Tox. 4 Oral Carc. 2 Eye Dam. 1 Lact. Repr. 1B STOT RE 1 |
| | 1-[4-(1H,1H,2H,2H-Perfluorodecyl)phenyl)-1,1-diphenylmethanol Usage And Synthesis |
| | 1-[4-(1H,1H,2H,2H-Perfluorodecyl)phenyl)-1,1-diphenylmethanol Preparation Products And Raw materials |
|