trans-2-Cyclopropylvinylboronic acid pinacol ester, 96% manufacturers
|
| | trans-2-Cyclopropylvinylboronic acid pinacol ester, 96% Basic information |
| Product Name: | trans-2-Cyclopropylvinylboronic acid pinacol ester, 96% | | Synonyms: | (E)-2-(2-cyclopropylvinyl)-4,4,5,5-tetraMethyl-1,3,2-dioxaborolane;trans-2-Cyclopropylvinylboronic acid pinacol ester, 96%;(E)-2-Cyclopropylethene-1-boronic acid, pinacol ester, trans-2-Cyclopropylvinylboronic acid, pinacol ester;(E)-2-Cyclopropylethylene-1-boronic acid, pinacol ester;(E)-2-Cyclopropylethylene-1-boronic acid, pinacol ester 97%;(trans)-2-Cyclopropylvinylboronic acid pinacol ester 96%;2-[(E)-2-cyclopropylethenyl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane;1,3,2-Dioxaborolane, 2-[(1E)-2-cyclopropylethenyl]-4,4,5,5-tetramethyl- | | CAS: | 849061-99-0 | | MF: | C11H19BO2 | | MW: | 194.08 | | EINECS: | | | Product Categories: | Alkenyl Boronate Esters;Boronate Esters;Boronic Acids and Derivatives;Chemical Synthesis;Organometallic Reagents | | Mol File: | 849061-99-0.mol |  |
| | trans-2-Cyclopropylvinylboronic acid pinacol ester, 96% Chemical Properties |
| Boiling point | 90-95 °C/3-4 mmHg(lit.) | | density | 0.937 g/mL at 25 °C(lit.) | | refractive index | n20/D 1.466(lit.) | | Fp | 93 °C | | storage temp. | under inert gas (nitrogen or Argon) at 2-8°C | | Appearance | Colorless to light yellow Liquid | | InChI | 1S/C11H19BO2/c1-10(2)11(3,4)14-12(13-10)8-7-9-5-6-9/h7-9H,5-6H2,1-4H3/b8-7+ | | InChIKey | FCWYPDPDAZGFRJ-BQYQJAHWSA-N | | SMILES | CC1(C)OB(OC1(C)C)\C=C\C2CC2 |
| WGK Germany | 3 | | HS Code | 2931900090 | | Storage Class | 10 - Combustible liquids |
| | trans-2-Cyclopropylvinylboronic acid pinacol ester, 96% Usage And Synthesis |
| | trans-2-Cyclopropylvinylboronic acid pinacol ester, 96% Preparation Products And Raw materials |
|