| Company Name: |
Alfa Aesar |
| Tel: |
400-6106006 |
| Email: |
saleschina@alfa-asia.com |
| Company Name: |
Energy Chemical |
| Tel: |
400-0056266 |
| Email: |
sales8178@energy-chemical.com |
|
| | E-2-(1-Pentenyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane Basic information |
| Product Name: | E-2-(1-Pentenyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane | | Synonyms: | TRANS-1-PENTENYL-1-BORONIC ACID PINACOL ESTER;TRANS-1-PENTENYLBORONIC ACID PINACOL ESTER;TRANS-4,4,5,5-TETRAMETHYL-2-PENT-1-ENYL-1,3,2-DIOXABOROLANE;trans-1-Penten-1-ylboronic acid pinacol ester, 97%;trans-1-Penten-1-ylboronic acid pinacol ester 97%;4,4,5,5-tetramethyl-2-[(E)-pent-1-enyl]-1,3,2-dioxaborolane;(E)-3-hydroxy-2,3-dimethylbutan-2-yl hydrogen pent-1-en-1-ylboronate;1-PENTENYL-1-BORONIC ACID, PINACOL ESTER | | CAS: | 161395-96-6 | | MF: | C11H21BO2 | | MW: | 196.09 | | EINECS: | | | Product Categories: | | | Mol File: | 161395-96-6.mol |  |
| | E-2-(1-Pentenyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane Chemical Properties |
| Boiling point | 110-111 °C28 mm Hg | | density | 0.884 g/mL at 25 °C | | refractive index | n20/D 1.441 | | Fp | 181 °F | | storage temp. | Sealed in dry,Store in freezer, under -20°C | | form | liquid | | color | Light yellow | | Water Solubility | Insoluble in water. | | InChI | 1S/C11H21BO2/c1-6-7-8-9-12-13-10(2,3)11(4,5)14-12/h8-9H,6-7H2,1-5H3/b9-8+ | | InChIKey | IMIHEZMTQOARIK-CMDGGOBGSA-N | | SMILES | CCC\C=C\B1OC(C)(C)C(C)(C)O1 | | CAS DataBase Reference | 161395-96-6 |
| RIDADR | NA 1993 / PGIII | | WGK Germany | 3 | | HS Code | 2931900090 | | Storage Class | 10 - Combustible liquids |
| | E-2-(1-Pentenyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane Usage And Synthesis |
| Uses | (E)-1-Pentenylboronic Acid Pinacol Ester is a reagent in the BACE-1 inhibitory activity of acyl guanidines. |
| | E-2-(1-Pentenyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane Preparation Products And Raw materials |
|