| Company Name: |
Alfa Aesar |
| Tel: |
400-6106006 |
| Email: |
saleschina@alfa-asia.com |
| Company Name: |
Energy Chemical |
| Tel: |
400-0056266 |
| Email: |
sales8178@energy-chemical.com |
|
| | 4,6-Dichloro-N-(4-fluorophenyl)-1,3,5-triazin-2-amine Basic information |
| Product Name: | 4,6-Dichloro-N-(4-fluorophenyl)-1,3,5-triazin-2-amine | | Synonyms: | 2,4-Dichloro-6-(4-fluorophenylamino)-1,3,5-triazine;1,3,5-Triazin-2-amine, 4,6-dichloro-N-(4-fluorophenyl)-;4,6-Dichloro-N-(4-fluorophenyl)-1,3,5-triazin-2-amine ISO 9001：2015 REACH | | CAS: | 131468-33-2 | | MF: | C9H5Cl2FN4 | | MW: | 259.07 | | EINECS: | | | Product Categories: | | | Mol File: | 131468-33-2.mol |  |
| | 4,6-Dichloro-N-(4-fluorophenyl)-1,3,5-triazin-2-amine Chemical Properties |
| form | solid | | InChI | InChI=1S/C9H5Cl2FN4/c10-7-14-8(11)16-9(15-7)13-6-3-1-5(12)2-4-6/h1-4H,(H,13,14,15,16) | | InChIKey | GVFNRSSFMJILLU-UHFFFAOYSA-N | | SMILES | N1=C(Cl)N=C(Cl)N=C1NC1=CC=C(F)C=C1 | | CAS DataBase Reference | 131468-33-2 |
| WGK Germany | WGK 3 | | HS Code | 2933698090 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Acute Tox. 4 Oral
Aquatic Acute 1
Aquatic Chronic 1
Eye Irrit. 2
Skin Irrit. 2
Skin Sens. 1 |
| | 4,6-Dichloro-N-(4-fluorophenyl)-1,3,5-triazin-2-amine Usage And Synthesis |
| | 4,6-Dichloro-N-(4-fluorophenyl)-1,3,5-triazin-2-amine Preparation Products And Raw materials |
|