- L-Tyr-Otbu
-
-
2026-09-17
- CAS:16874-12-7
- Min. Order: 1kg
- Purity: 98%
- Supply Ability: 1T+
|
| | tert-Butyl L-tyrosinate Basic information |
| | tert-Butyl L-tyrosinate Chemical Properties |
| Melting point | 141-144 °C | | Boiling point | 358.1±27.0 °C(Predicted) | | density | 1.125±0.06 g/cm3(Predicted) | | refractive index | 25 ° (C=2, EtOH) | | storage temp. | Keep in dark place,Inert atmosphere,Room temperature | | solubility | soluble in Methanol | | pka | 9.80±0.15(Predicted) | | form | Powder | | color | White | | Optical Rotation | [α]20/D +25±1°, c = 2% in ethanol | | BRN | 2696011 | | Major Application | peptide synthesis | | InChI | InChI=1S/C13H19NO3/c1-13(2,3)17-12(16)11(14)8-9-4-6-10(15)7-5-9/h4-7,11,15H,8,14H2,1-3H3/t11-/m0/s1 | | InChIKey | DIGHFXIWRPMGSA-NSHDSACASA-N | | SMILES | C(OC(C)(C)C)(=O)[C@H](CC1=CC=C(O)C=C1)N | | CAS DataBase Reference | 16874-12-7(CAS DataBase Reference) |
| Safety Statements | 22-24/25 | | WGK Germany | 3 | | HS Code | 29225090 | | Storage Class | 11 - Combustible Solids |
| | tert-Butyl L-tyrosinate Usage And Synthesis |
| Chemical Properties | Crystalline | | Uses | L-Tyrosine tert-butyl ester is a protected form of L-Tyrosine (T899975). L-Tyrosine is an essential amino acid that exhibits in vitro antioxidant and antiradical activities. L-Tyrosine is used as a precursor to synthesize catecholamines (e.g. Norepinephrine HCl [N674500]) in human keratinocytes, and also for the synthesis of proteins and thyroid hormones. | | reaction suitability | reaction type: solution phase peptide synthesis | | Synthesis | To a solution of tert-butyl (S)-4-benzyloxyphenylalaninate (65.5 mg, 0.2 mmol) in tetrahydrofuran (2 mL) was added palladium (10 mg) on 10% activated charcoal at zero degrees Celsius under an argon atmosphere, then the reaction system was bubbled with H2 to replace the air in the reaction flask, and the reaction mixture was stirred and reacted for 6 hours at room temperature in a hydrogen atmosphere, and then the reaction The reaction mixture was then filtered to remove the catalyst, and the resulting filtrate was concentrated under vacuum, and finally the target product L-tyrosine tert-butyl ester was obtained by isolation and purification of the residue by silica gel column chromatography (using ethyl acetate as eluent). |
| | tert-Butyl L-tyrosinate Preparation Products And Raw materials |
|