|
|
| | 4-(p-Chlorophenoxy)butyric acid Basic information |
| Product Name: | 4-(p-Chlorophenoxy)butyric acid | | Synonyms: | ASINEX-REAG BAS 14577961;AKOS B030625;TIMTEC-BB SBB008253;OTAVA-BB BB7020401725;4-(4-Chlorophenoxy)butyric acid;JR-8184, 4-(4-Chlorophenoxy)butanoic acid, 97%;4-(4-CPB);4-CPB | | CAS: | 3547-07-7 | | MF: | C10H11ClO3 | | MW: | 214.65 | | EINECS: | | | Product Categories: | | | Mol File: | 3547-07-7.mol |  |
| | 4-(p-Chlorophenoxy)butyric acid Chemical Properties |
| Melting point | 120 °C | | Boiling point | 308.11°C (rough estimate) | | density | 1.2413 (rough estimate) | | refractive index | 1.5390 (estimate) | | storage temp. | Sealed in dry,Room Temperature | | form | solid | | pka | 4.58±0.10(Predicted) | | Appearance | White to off-white Solid | | Water Solubility | 0.11g/L(25 ºC) | | InChI | 1S/C10H11ClO3/c11-8-3-5-9(6-4-8)14-7-1-2-10(12)13/h3-6H,1-2,7H2,(H,12,13) | | InChIKey | SIYAHZSHQIPQLY-UHFFFAOYSA-N | | SMILES | O=C(CCCOC1=CC=C(C=C1)Cl)O |
| WGK Germany | WGK 3 | | HazardClass | IRRITANT | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Acute Tox. 4 Oral Eye Dam. 1 |
| | 4-(p-Chlorophenoxy)butyric acid Usage And Synthesis |
| | 4-(p-Chlorophenoxy)butyric acid Preparation Products And Raw materials |
|