Coproporphyrin I dihydrochloride manufacturers
|
| | Coproporphyrin I dihydrochloride Basic information |
| Product Name: | Coproporphyrin I dihydrochloride | | Synonyms: | 3,8,13,18-TETRAMETHYL-21H,23H-PORPHINE-2,7,12,17-TETRAPROPIONIC ACID DIHYDROCHLORIDE;Coproporphyrin I dihydrochloride (synthetic);CoproporphyrinIdihydrochloridesyntheticpurplextl;coproporphyrini2HCl(synthetic);21H,23H-Porphine-2,7,12,17-tetrapropanoic acid, 3,8,13,18-tetramethyl-, hydrochloride (1:2);Sudan Impurity 27;Coproporphyrin I Dihydrochloride, >85% (contains Coproporphyrin lll);synthetic | | CAS: | 69477-27-6 | | MF: | C36H39ClN4O8 | | MW: | 691.18 | | EINECS: | | | Product Categories: | Natural Porphyrins and Derivitives;Porphyrins;porphine (porphyrin) ligand | | Mol File: | 69477-27-6.mol |  |
| | Coproporphyrin I dihydrochloride Chemical Properties |
| storage temp. | −20°C | | solubility | DMSO (Slightly), Methanol (Slightly) | | form | crystal | | color | purple | | λmax | 395 nm | | Stability: | Hygroscopic | | InChIKey | JYLWDKRXZGYVRO-MXOXSBADSA-N | | SMILES | C(C1C(=C2C=C3N=C(C=C4C(CCC(=O)O)=C(C)C(N4)=CC4C(CCC(=O)O)=C(C)C(N=4)=CC=1N2)C(C)=C3CCC(=O)O)C)CC(=O)O.Cl |c:4,t:8,20,33| |
| WGK Germany | 3 | | Storage Class | 11 - Combustible Solids |
| | Coproporphyrin I dihydrochloride Usage And Synthesis |
| Uses | Coproporphyrin I Dihydrochloride is a porphyrin biomarker with an absorption of λmax 395 nm. | | reaction suitability | core: porphyrin
reagent type: catalyst |
| | Coproporphyrin I dihydrochloride Preparation Products And Raw materials |
|