|
|
| | Prochlorperazine Sulfoxide Basic information |
| Product Name: | Prochlorperazine Sulfoxide | | Synonyms: | 2-Chloro-10-[3-(4-methyl-1-piperazinyl)propyl]-10H-phenothiazine 5-Oxide;Prochlorperazine Sulfoxide;2-chloro-10-[3-(4-methylpiperazin-1-yl)propyl]phenothiazine 5-oxide;10H-Phenothiazine, 2-chloro-10-[3-(4-methyl-1-piperazinyl)propyl]-, 5-oxide;Prochlorperazine 'S' isomer impurity;Prochlorperazine SulfoxideQ: What is
Prochlorperazine Sulfoxide Q: What is the CAS Number of
Prochlorperazine Sulfoxide Q: What is the storage condition of
Prochlorperazine Sulfoxide Q: What are the applications of
Prochlorperazine Sulfoxide;Prochlorperazine Maleate Impurity A;Prochlorperazine Maleate EP Impurity A | | CAS: | 10078-27-0 | | MF: | C20H24ClN3OS | | MW: | 389.94 | | EINECS: | | | Product Categories: | Various Metabolites and Impurities;Intermediates & Fine Chemicals;Metabolites & Impurities;Pharmaceuticals | | Mol File: | 10078-27-0.mol |  |
| | Prochlorperazine Sulfoxide Chemical Properties |
| Melting point | 164-1650C | | Boiling point | 569.7±50.0 °C(Predicted) | | density | 1.37±0.1 g/cm3(Predicted) | | storage temp. | Refrigerator | | solubility | DMSO (Slightly), Methanol (Slightly) | | pka | 7.65±0.10(Predicted) | | form | Solid | | color | White to Off-White | | Major Application | pharmaceutical
pharmaceutical small molecule | | InChI | 1S/C20H24ClN3OS/c1-22-11-13-23(14-12-22)9-4-10-24-17-5-2-3-6-19(17)26(25)20-8-7-16(21)15-18(20)24/h2-3,5-8,15H,4,9-14H2,1H3 | | InChIKey | AZGYHFQQUZPAFZ-UHFFFAOYSA-N | | SMILES | [S]1(=O)c2c(cc(cc2)Cl)N(c4c1cccc4)CCCN3CCN(CC3)C | | CAS DataBase Reference | 10078-27-0 |
| WGK Germany | WGK 3 | | Storage Class | 11 - Combustible Solids |
| | Prochlorperazine Sulfoxide Usage And Synthesis |
| Chemical Properties | White Crystalline Solid | | Uses | A metabolite of Prochlorperazine. |
| | Prochlorperazine Sulfoxide Preparation Products And Raw materials |
|