| Company Name: |
BOC Sciences |
| Tel: |
16314854226 |
| Email: |
info@bocsci.com |
|
| | ChlorproMazine Sulfoxide Basic information |
| Product Name: | ChlorproMazine Sulfoxide | | Synonyms: | Chlorpromazine-S-oxide;3-(2-chloro-5-keto-phenothiazin-10-yl)propyl-dimethyl-amine;3-(2-chloro-5-oxo-phenothiazin-10-yl)-N,N-dimethyl-propan-1-amine;3-(2-chloro-5-oxophenothiazin-10-yl)-N,N-dimethylpropan-1-amine;Chlorpromazine impurity 1/Chlorpromazine EP Impurity A/Chlorpromazine Sulfoxide/2-Chloro-N,N-dimethyl-10H-Phenothiazine-10-propanamine 5-Oxide;10H-Phenothiazine-10-propanamine,2-chloro-N,N-dimethyl-, 5-oxide;3-(2-Chloro-10H-phenothiazin-10-yl)-N,N-dimethylpropan-1- amine S-oxide;Chlorpromazine EP impurity A | | CAS: | 969-99-3 | | MF: | C17H19ClN2OS | | MW: | 334.86 | | EINECS: | | | Product Categories: | Amines, Pharmaceuticals, Intermediates & Fine Chemicals, Sulfur & Selenium Compounds | | Mol File: | 969-99-3.mol |  |
| | ChlorproMazine Sulfoxide Chemical Properties |
| Melting point | 115° | | Boiling point | 502.6±50.0 °C(Predicted) | | density | 1.35±0.1 g/cm3(Predicted) | | storage temp. | Refrigerator, Under Inert Atmosphere | | solubility | Chloroform (Sparingly), Methanol (Slightly) | | pka | pKa 9.0 (Uncertain) | | form | solid | | color | Off-White to Brown | | Major Application | pharmaceutical (small molecule) | | InChI | 1S/C17H19ClN2OS/c1-19(2)10-5-11-20-14-6-3-4-7-16(14)22(21)17-9-8-13(18)12-15(17)20/h3-4,6-9,12H,5,10-11H2,1-2H3 | | InChIKey | QEPPAOXKZOTMPM-UHFFFAOYSA-N | | SMILES | [S+]1(c2c(cc(cc2)Cl)N(c3c1cccc3)CCCN(C)C)[O-] |
| RIDADR | UN 2811 6.1 / PGIII | | WGK Germany | WGK 3 | | Storage Class | 11 - Combustible Solids | | Toxicity | LD50 s.c. in mice: 102 mg/kg (Minami, Yoshimoto) |
| | ChlorproMazine Sulfoxide Usage And Synthesis |
| Uses | Chlorpromazine Sulfoxide is a derivative of Chlorpromazine Hydrochloride (C424750), which is a dopamine antagonist of the typical antipsychotic class of medications possessing additional antiadrenergic, antiserotonergic, anticholinergic and antihistaminergic properties used for schizophrenia treatment. | | Definition | ChEBI: 3-(2-chloro-5-oxo-10-phenothiazinyl)-N,N-dimethyl-1-propanamine is a member of phenothiazines. |
| | ChlorproMazine Sulfoxide Preparation Products And Raw materials |
|