| Company Name: |
T&W GROUP |
| Tel: |
021-61551611 13296011611 |
| Email: |
contact@trustwe.com |
|
| | 9-(2-Deoxy-2-fluoro-beta-D-arabinofuranosyl)adenine Basic information |
| | 9-(2-Deoxy-2-fluoro-beta-D-arabinofuranosyl)adenine Chemical Properties |
| Melting point | 233-234 °C | | Boiling point | 628.6±65.0 °C(Predicted) | | density | 2.01 | | storage temp. | 2-8°C, protect from light | | pka | 12.60±0.70(Predicted) | | form | Solid | | color | White to off-white | | InChI | InChI=1/C10H12FN5O3/c11-5-7(18)4(1-17)19-10(5)16-3-15-6-8(12)13-2-14-9(6)16/h2-5,7,10,17-18H,1H2,(H2,12,13,14)/t4-,5+,7-,10-/s3 | | InChIKey | ZGYYPTJWJBEXBC-VNCZOPGJNA-N | | SMILES | [C@H]1(O)[C@H](F)[C@@H](O[C@@H]1CO)N1C2N=CN=C(N)C=2N=C1 |&1:0,2,4,6,r| |
| | 9-(2-Deoxy-2-fluoro-beta-D-arabinofuranosyl)adenine Usage And Synthesis |
| Uses | 2'-Deoxy-2'-fluoroarabinoadenosine is a nucleoside analogue, which exhibits anticancer activity against human immunodeficiency virus (HIV)[1]. | | References | [1] Marquez VE, et al., 2',3'-Dideoxy-2'-fluoro-ara-A. An acid-stable purine nucleoside active against human immunodeficiency virus (HIV). Biochem Pharmacol. 1987 Sep 1;36(17):2719-22. DOI:10.1016/0006-2952(87)90254-1 |
| | 9-(2-Deoxy-2-fluoro-beta-D-arabinofuranosyl)adenine Preparation Products And Raw materials |
|