|
|
| | N-Acetyl-5-aminosalicylic acid Basic information |
| | N-Acetyl-5-aminosalicylic acid Chemical Properties |
| Melting point | 228-230°C | | Boiling point | 480.2±40.0 °C(Predicted) | | density | 1.462±0.06 g/cm3(Predicted) | | storage temp. | 2-8°C | | solubility | DMSO (Slightly), Methanol (Slightly) | | pka | 2.88±0.10(Predicted) | | form | Solid | | color | White to Tan | | Stability: | Hygroscopic | | Major Application | pharmaceutical | | InChI | 1S/C9H9NO4/c1-5(11)10-6-2-3-8(12)7(4-6)9(13)14/h2-4,12H,1H3,(H,10,11)(H,13,14) | | InChIKey | GEFDRROBUCULOD-UHFFFAOYSA-N | | SMILES | CC(=O)Nc1ccc(O)c(c1)C(O)=O | | CAS DataBase Reference | 51-59-2 |
| Risk Statements | 36 | | Safety Statements | 26 | | WGK Germany | WGK 3 | | HS Code | 2918290090 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Acute Tox. 4 Oral
Eye Irrit. 2 |
| | N-Acetyl-5-aminosalicylic acid Usage And Synthesis |
| Chemical Properties | Light-Borwn Cyrstals | | Uses | A metabolite of Mesalazine. A Salicylic Acid derivative. Inhibitor of recombinant human thiopurine methyltransferase (hTPMT) | | Uses | A labelled metabolite of Mesalazine. A labelled Salicylic Acid derivative. Inhibitor of recombinant human thiopurine methyltransferase (hTPMT) | | Uses | N-Acetyl Mesalazine is an metabolite of Mesalazine. A Salicylic Acid derivative. Inhibitor of recombinant human thiopurine methyltransferase (hTPMT). | | Definition | ChEBI: N-acetyl-5-aminosalicylic acid is an aminobenzoic acid. |
| | N-Acetyl-5-aminosalicylic acid Preparation Products And Raw materials |
|