| Company Name: |
Sigma-Aldrich |
| Tel: |
021-61415566 800-8193336 |
| Email: |
orderCN@merckgroup.com |
|
| | (+)-trans-Limonene 1,2-epoxide Basic information |
| Product Name: | (+)-trans-Limonene 1,2-epoxide | | Synonyms: | (1S,2R,4R)-4-ISOPROPENYL-1-METHYL-1-CYCLOHEXENE 1,2-EPOXIDE;(1S,4R)-1,2-EPOXY-P-MENTH-8-ENE;(+)-TRANS-P-MENTHA-1,8-DIENE 1,2-EPOXIDE;(+)-trans-limonene oxide;trans-Limonen-1,2-epoxide;trans-Limonene oxyde;(+)-trans-p-Mentha-1,8-diene 1,2-epoxide, (1S,2R,4R)-4-Isopropenyl-1-methyl-1-cyclohexene 1,2-epoxide, (1S,4R)-1,2-Epoxy-p-menth-8-ene;(1R,2S,4S)-1,2-Epoxy-p-mentha-8-ene | | CAS: | 6909-30-4 | | MF: | C10H16O | | MW: | 152.23 | | EINECS: | | | Product Categories: | EPOXYDE | | Mol File: | 6909-30-4.mol |  |
| | (+)-trans-Limonene 1,2-epoxide Chemical Properties |
| Boiling point | 198.1±9.0 °C(Predicted) | | density | 0.930 g/mL at 20 °C(lit.) | | refractive index | n20/D 1.466 | | Fp | 65 °C | | storage temp. | 2-8°C | | form | liquid | | Odor | at 100.00%. green | | Optical Rotation | [α]20/D +90±2°, neat | | BRN | 80940 | | Major Application | food and beverages | | InChI | 1S/C10H16O/c1-7(2)8-4-5-10(3)9(6-8)11-10/h8-9H,1,4-6H2,2-3H3/t8-,9-,10+/m1/s1 | | InChIKey | CCEFMUBVSUDRLG-BBBLOLIVSA-N | | SMILES | CC([C@@H]1CC[C@@]2(C)[C@@](O2)([H])C1)=C | | LogP | 3.200 (est) |
| WGK Germany | 3 | | F | 10-21 | | Storage Class | 10 - Combustible liquids |
| | (+)-trans-Limonene 1,2-epoxide Usage And Synthesis |
| Uses | (+)-trans-Limonene Oxide is a reagent used in the preparation of P-stereogenic secondary phosphine oxides. Also used in the synthesis of novel hydroxyurethanes. | | Definition | ChEBI: (4R)-limonene 1alpha,2alpha-epoxide is a (4R)-limonene 1,2-epoxide. |
| | (+)-trans-Limonene 1,2-epoxide Preparation Products And Raw materials |
|