| Company Name: |
Energy Chemical Gold |
| Tel: |
400-0056266 |
| Email: |
sales8178@energy-chemical.com |
| Company Name: |
Energy Chemical Gold |
| Tel: |
400-0056266 |
| Email: |
marketing1@energy-chemical.com |
- Kryptofix 222
-
- $10.00
-
2019-07-06
- CAS:23978-09-8
- Min. Order: 1KG
- Purity: 99%
- Supply Ability: 100
|
| | Kryptofix 222 Basic information |
| | Kryptofix 222 Chemical Properties |
| Melting point | 68-71 °C(lit.) | | Boiling point | 505.03°C (rough estimate) | | density | 1.1888 (rough estimate) | | refractive index | 1.5700 (estimate) | | storage temp. | Store at +2°C to +8°C. | | solubility | Chloroform (Slightly), Methanol (Slightly, Heated) | | form | Solid | | pka | 7.21±0.20(Predicted) | | color | White to Off-White | | Water Solubility | soluble | | BRN | 620282 | | InChI | InChI=1S/C18H36N2O6/c1-7-21-13-14-24-10-4-20-5-11-25-17-15-22-8-2-19(1)3-9-23-16-18-26-12-6-20/h1-18H2 | | InChIKey | AUFVJZSDSXXFOI-UHFFFAOYSA-N | | SMILES | N12CCOCCOCCN(CCOCCOCC1)CCOCCOCC2 | | CAS DataBase Reference | 23978-09-8(CAS DataBase Reference) | | NIST Chemistry Reference | 4,7,13,16,21,24-Hexaoxa-1,10-diazabicyclo[8.8.8]hexacosane(23978-09-8) |
| Hazard Codes | Xi,Xn | | Risk Statements | 36/37/38-22 | | Safety Statements | 26-36-36/37/39 | | WGK Germany | 3 | | RTECS | MP4750000 | | HS Code | 2934 99 90 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Acute Tox. 4 Oral Eye Dam. 1 Skin Irrit. 2 | | Toxicity | LD50 orally in Rabbit: > 300 - 2000 mg/kg |
| | Kryptofix 222 Usage And Synthesis |
| Chemical Properties | Colourless crystals | | Uses | Kryptofix 222 is used in the synthesis of hybrid metal-organic salts. It is also an impurity in the preparation of Fludeoxyglucose (D232570), a D-Glucose (G595000) derivative used in the synthesis of sugar nucleotides and oligosaccharides. |
| | Kryptofix 222 Preparation Products And Raw materials |
|