| Company Name: |
BOC Sciences |
| Tel: |
1-631-485-4226; 16314854226 |
| Email: |
info@bocsci.com |
| Company Name: |
Sigma-Aldrich |
| Tel: |
021-61415566 800-8193336 |
| Email: |
orderCN@merckgroup.com |
|
| | 5-Chloro-N-(cyclopropylmethyl)-2-methyl-N-propyl-N'-(2,4,6-trichlorophenyl)-4,6-pyrimidinediamine hydrochloride Basic information |
| Product Name: | 5-Chloro-N-(cyclopropylmethyl)-2-methyl-N-propyl-N'-(2,4,6-trichlorophenyl)-4,6-pyrimidinediamine hydrochloride | | Synonyms: | NBI 27914 HYDROCHLORIDE;5-Chloro-N-(cyclopropylmethyl)-2-methyl-N-propyl-N'-(2,4,6-trichlorophenyl)-4,6-pyrimidinediaminehydrochloride;NBI27914HCl;NBI 27914 >=98% (HPLC);NBI 27914 hydrochlor;4,6-Pyrimidinediamine, 5-chloro-N4-(cyclopropylmethyl)-2-methyl-N4-propyl-N6-(2,4,6-trichlorophenyl)-;NBI 27914[N3911];5-Chloro-N-(cyclopropylmethyl)-2-methyl-N-propyl-N'-(2,4,6-trichlorophenyl)-4,6-pyrimidinediamine hydrochloride | | CAS: | 184241-44-9 | | MF: | C18H20Cl4N4 | | MW: | 434.19 | | EINECS: | | | Product Categories: | CRF receptor and related | | Mol File: | 184241-44-9.mol |  |
| | 5-Chloro-N-(cyclopropylmethyl)-2-methyl-N-propyl-N'-(2,4,6-trichlorophenyl)-4,6-pyrimidinediamine hydrochloride Chemical Properties |
| Boiling point | 483.7±45.0 °C(Predicted) | | density | 1.417±0.06 g/cm3(Predicted) | | storage temp. | 2-8°C | | solubility | DMSO: 16 mg/mL at 60 °C, soluble | | form | solid | | pka | 3.58±0.50(Predicted) | | color | white | | InChI | 1S/C18H20Cl4N4/c1-3-6-26(9-11-4-5-11)18-15(22)17(23-10(2)24-18)25-16-13(20)7-12(19)8-14(16)21/h7-8,11H,3-6,9H2,1-2H3,(H,23,24,25) | | InChIKey | KNADXBVKFAUMCR-UHFFFAOYSA-N | | SMILES | CCCN(CC1CC1)c2nc(C)nc(Nc3c(Cl)cc(Cl)cc3Cl)c2Cl |
| Hazard Codes | Xi | | Risk Statements | 36/37/38 | | Safety Statements | 26-36 | | WGK Germany | 3 | | Storage Class | 11 - Combustible Solids |
| | 5-Chloro-N-(cyclopropylmethyl)-2-methyl-N-propyl-N'-(2,4,6-trichlorophenyl)-4,6-pyrimidinediamine hydrochloride Usage And Synthesis |
| Uses | NBI 27914 has been used as acorticotropin-releasing hormone receptor (CRHR1) antagonist:
- to study its effects on steroidogenic gene expression in GD15 mouse testis
- to study its effects on amyloid β production
- to study its effects on neurogenic activity of neural stem cells in the adult hippocampus
| | Definition | ChEBI: 5-chloro-N4-(cyclopropylmethyl)-2-methyl-N4-propyl-N6-(2,4,6-trichlorophenyl)pyrimidine-4,6-diamine is a dialkylarylamine and a tertiary amino compound. | | Biological Activity | Selective, non-peptide corticotropin-releasing factor 1 (CRF 1 ) receptor antagonist (K i = 1.7 nM); has no activity at CRF 2 receptors. Blocks behavioral seizures in vivo . | | Biochem/physiol Actions | NBI 27914 is a CRF1 corticotropin-releasing factor receptor antagonist. |
| | 5-Chloro-N-(cyclopropylmethyl)-2-methyl-N-propyl-N'-(2,4,6-trichlorophenyl)-4,6-pyrimidinediamine hydrochloride Preparation Products And Raw materials |
|