|
|
| | 4-Pyridylamidoxime Basic information |
| | 4-Pyridylamidoxime Chemical Properties |
| Melting point | 128-133 °C (lit.) | | Boiling point | 278℃ | | density | 1.31 | | Fp | 122℃ | | storage temp. | under inert gas (nitrogen or Argon) at 2–8 °C | | solubility | DMF: 15 mg/ml; DMSO: 20 mg/ml; Ethanol: 0.3 mg/ml; PBS (pH 7.2): 0.15 mg/ml | | pka | 13.00±0.50(Predicted) | | form | Crystalline Solid | | color | White to off-white | | λmax | 268nm(H2O)(lit.) | | InChI | InChI=1S/C6H7N3O/c7-6(9-10)5-1-3-8-4-2-5/h1-4,10H,(H2,7,9) | | InChIKey | ZUUATXHRJFHSGO-UHFFFAOYSA-N | | SMILES | C1=NC=CC(C(NO)=N)=C1 | | CAS DataBase Reference | 1594-57-6(CAS DataBase Reference) |
| Hazard Codes | Xi | | Risk Statements | 36/37/38 | | Safety Statements | 26-36 | | WGK Germany | 3 | | RTECS | NS1050000 | | HazardClass | IRRITANT | | HS Code | 29333990 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |
| | 4-Pyridylamidoxime Usage And Synthesis |
| Chemical Properties | White to off-white solid or powder | | Uses | 4-Pyridylamidoxime may be used in the synthesis of substituted α-1,2,4-oxadiazolo esters. |
| | 4-Pyridylamidoxime Preparation Products And Raw materials |
|