N(4)-methylcytidine manufacturers
- N4-Methylcytidine
-
- $0.00 / 1removed
-
2026-04-22
- CAS:10578-79-7
- Min. Order:
- Purity: 98.36%
- Supply Ability: 10g
- N(4)-methylcytidine
-
- $7.00 / 1KG
-
2019-09-02
- CAS: 10578-79-7
- Min. Order: 1KG
- Purity: 99%
- Supply Ability: JD 555
|
| | N(4)-methylcytidine Basic information |
| Product Name: | N(4)-methylcytidine | | Synonyms: | N(4)-methylcytidine;Nsc518744;Cytidine, N-Methyl-;4-Methylcytidine;1-[(2R,3R,4S,5R)-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]-4-(methylamino)pyrimidin-2-one;N4-Methyl-Cr;N4-Methylcytidine, RNA modified nucleoside m4C;N4-Me-rC | | CAS: | 10578-79-7 | | MF: | C10H15N3O5 | | MW: | 257.24 | | EINECS: | | | Product Categories: | | | Mol File: | 10578-79-7.mol |  |
| | N(4)-methylcytidine Chemical Properties |
| Melting point | 202-203 °C(Solv: ethanol (64-17-5)) | | Boiling point | 504.2±60.0 °C(Predicted) | | density | 1.69±0.1 g/cm3(Predicted) | | storage temp. | 2-8°C(protect from light) | | solubility | Aqueous Acid (Slightly), DMSO (Slightly), Methanol (Slightly), Water (Slightly) | | form | Solid | | pka | 13.48±0.70(Predicted) | | color | Off-White to Beige | | Stability: | Hygroscopic | | InChI | InChI=1S/C10H15N3O5/c1-11-6-2-3-13(10(17)12-6)9-8(16)7(15)5(4-14)18-9/h2-3,5,7-9,14-16H,4H2,1H3,(H,11,12,17)/t5-,7-,8-,9-/m1/s1 | | InChIKey | LZCNWAXLJWBRJE-ZOQUXTDFSA-N | | SMILES | OC[C@H]1O[C@@H](N2C=CC(NC)=NC2=O)[C@H](O)[C@@H]1O |
| | N(4)-methylcytidine Usage And Synthesis |
| Description | N4-Methylcytidine is a nucleoside analogue that inhibits synthesis of human mitochondrial DNA by inhibiting bacterial enzyme uridine-cytidine kinase, which converts uridine to cytidine in the mitochondria. N4-Methylcytidine has been shown to be potent against viruses such as HIV and herpes simplex virus type 1 (HSV-1) in cell culture studies. This antiviral effect is due to the interference with viral dna replication and protein synthesis by preventing incorporation of uracil into dna and ribosomal RNA. | | Uses | N4-Methylcytidine (Nsc518744) is a cytidine nucleoside analog. Cytidine analogs have a mechanism of inhibiting DNA methyltransferases (such as Zebularine, HY-13420), and have potential anti-metabolic and anti-tumor activities[1]. | | Definition | ChEBI: N4-Methylcytidine is a pyrimidine nucleoside. | | References | [1] Gowher H, et al. Mechanism of inhibition of DNA methyltransferases by cytidine analogs in cancer therapy. Cancer Biol Ther. 2004 Nov;3(11):1062-8. DOI:10.4161/cbt.3.11.1308 |
| | N(4)-methylcytidine Preparation Products And Raw materials |
|