| Company Name: |
Alfa Aesar |
| Tel: |
400-6106006 |
| Email: |
saleschina@alfa-asia.com |
| Company Name: |
Energy Chemical |
| Tel: |
400-0056266 |
| Email: |
sales8178@energy-chemical.com |
|
| | 2,4-Dichloro-6-nitroaniline Basic information |
| Product Name: | 2,4-Dichloro-6-nitroaniline | | Synonyms: | TIMTEC-BB SBB003479;2,4-DICHLORO-6-NITRO-PHENYLAMINE;Benzenamine, 2,4-dichloro-6-nitro-;4,6-DICHLORO-2-NITROANILINE;2,4-DICHLORO-6-NITROBENZENAMINE;2,4-DICHLORO-6-NITROANILINE 99%;2-Nitro-4,6-dichloroaniline;2,4-Dichloro-6-nitroaniline,99% | | CAS: | 2683-43-4 | | MF: | C6H4Cl2N2O2 | | MW: | 207.01 | | EINECS: | 220-241-7 | | Product Categories: | Amines;C2 to C6;Nitrogen Compounds;Building Blocks;Chemical Synthesis;Nitrogen Compounds;Organic Building Blocks;C6 | | Mol File: | 2683-43-4.mol |  |
| | 2,4-Dichloro-6-nitroaniline Chemical Properties |
| Melting point | 101-103 °C (lit.) | | Boiling point | 360.98°C (rough estimate) | | density | 1.6257 (rough estimate) | | refractive index | 1.6100 (estimate) | | storage temp. | Keep in dark place,Inert atmosphere,Room temperature | | solubility | Chloroform (Slightly), DMSO (Slightly) | | form | Solid | | pka | pK1:-3.00(+1) (25°C) | | color | Yellow to Very Dark Yellow | | BRN | 642902 | | InChI | 1S/C6H4Cl2N2O2/c7-3-1-4(8)6(9)5(2-3)10(11)12/h1-2H,9H2 | | InChIKey | IZEZAMILKKYOPW-UHFFFAOYSA-N | | SMILES | Nc1c(Cl)cc(Cl)cc1[N+]([O-])=O | | CAS DataBase Reference | 2683-43-4(CAS DataBase Reference) | | EPA Substance Registry System | 2,4-Dichloro-6-nitroaniline (2683-43-4) |
| Hazard Codes | Xn,N,T+ | | Risk Statements | 20/21/22-36/37/38-51/53-33-26/27/28 | | Safety Statements | 26-37/39-61-45-36/37-28 | | RIDADR | UN 2811 6.1/PG 3 | | WGK Germany | 3 | | HazardClass | 6.1 | | PackingGroup | III | | Storage Class | 6.1A - Combustible acute toxic Cat. 1 and 2
very toxic hazardous materials | | Hazard Classifications | Acute Tox. 1 Dermal
Acute Tox. 1 Inhalation
Acute Tox. 1 Oral
Aquatic Chronic 2
STOT RE 2 |
| | 2,4-Dichloro-6-nitroaniline Usage And Synthesis |
| Chemical Properties | YELLOW FLUFFY POWDER | | Uses | 2,4-Dichloro-6-nitroaniline was used to design a faster-reacting, more intensely fluorescent pH probe based on rhodamine spirolactam structure. |
| | 2,4-Dichloro-6-nitroaniline Preparation Products And Raw materials |
|