|
|
| | 4,5-Dichloro-2-nitroaniline Basic information |
| Product Name: | 4,5-Dichloro-2-nitroaniline | | Synonyms: | Benzenamine, 4,5-dichloro-2-nitro-;TIMTEC-BB SBB003477;4,5-DICHLORO-2-NITROANILINE;2-Nitro-4,5-dichlorobenzenamine;4,5-Dichloro-2-nitroaniline ,98%;4,5-Dichloro-2-nitroaniline 98%;2-NITRO-4,5-DICHLOROANILINE;4,5-Dichloro-2-nitro-phenylamine | | CAS: | 6641-64-1 | | MF: | C6H4Cl2N2O2 | | MW: | 207.01 | | EINECS: | 229-657-3 | | Product Categories: | Anilines, Aromatic Amines and Nitro Compounds;API intermediates;Anilines, Amides & Amines;Chlorine Compounds;Nitro Compounds;C2 to C6;Nitrogen Compounds;Amines;blocks;NitroCompounds;Amines and Anilines | | Mol File: | 6641-64-1.mol |  |
| | 4,5-Dichloro-2-nitroaniline Chemical Properties |
| Melting point | 177-179 °C (lit.) | | Boiling point | 347.1±37.0 °C(Predicted) | | density | 1.624±0.06 g/cm3(Predicted) | | vapor pressure | 0.199Pa at 78.175℃ | | storage temp. | Keep in dark place,Inert atmosphere,Room temperature | | solubility | DMSO (Slightly), Methanol (Slightly) | | form | powder to crystal | | pka | -2.24±0.25(Predicted) | | color | Light yellow to Brown | | Water Solubility | 60.3mg/L at 25℃ | | InChI | InChI=1S/C6H4Cl2N2O2/c7-3-1-5(9)6(10(11)12)2-4(3)8/h1-2H,9H2 | | InChIKey | FSGTULQLEVAYRS-UHFFFAOYSA-N | | SMILES | C1(N)=CC(Cl)=C(Cl)C=C1[N+]([O-])=O | | LogP | 3.31 at 25℃ | | CAS DataBase Reference | 6641-64-1(CAS DataBase Reference) | | NIST Chemistry Reference | 4,5-Dichloro-2-nitroaniline(6641-64-1) | | EPA Substance Registry System | 4,5-Dichloro-2-nitroaniline (6641-64-1) |
| Hazard Codes | Xn | | Risk Statements | 20/21/22-36/37/38 | | Safety Statements | 26-37/39-36/37/39-22 | | RIDADR | 2811 | | WGK Germany | 3 | | Hazard Note | Harmful | | HazardClass | 6.1(b) | | PackingGroup | III | | HS Code | 29214200 | | Storage Class | 6.1A - Combustible acute toxic Cat. 1 and 2 very toxic hazardous materials | | Hazard Classifications | Acute Tox. 1 Dermal Acute Tox. 2 Inhalation Acute Tox. 2 Oral Aquatic Chronic 2 STOT RE 2 |
| | 4,5-Dichloro-2-nitroaniline Usage And Synthesis |
| Chemical Properties | Brown powder | | Flammability and Explosibility | Not classified |
| | 4,5-Dichloro-2-nitroaniline Preparation Products And Raw materials |
| Raw materials | 3,4-DICHLOROACETANILIDE-->1,2-DICHLORO-4,5-DINITRO-BENZENE-->N1-(4,5-DICHLORO-2-NITROPHENYL)ACETAMIDE-->3,4-Dichloroaniline-->1,2,4-Trichloro-5-nitrobenzene-->1,2-Dichlorobenzene-->Ammonia | | Preparation Products | 2,3-dichloro-6-nitroaniline-->4-CHLORO-2-NITRO-5-(1-PYRROLIDINYL)ANILINE-->5,6-Dichloroquinolin-8-aMine |
|