|
|
| Product Name: | OMPI | | Synonyms: | OMPI;1-(2-Mercaptoethyl)-4-phenyl-2-imidazolidinone;2-Oxo-3-(2-mercaptoethyl)-5-phenylimidazolidine;DL-2-Oxo-3-(2-Mercaptoethyl)-5-phenyliMidazolidine;1-(2-Mercaptoethyl)-4-phenyliMidazolidin-2-one;Levamisole EP Impurity C;2-Imidazolidinone, 1-(2-mercaptoethyl)-4-phenyl-;Levamisole Impurity 3（Levamisole EP Impurity C） | | CAS: | 32190-33-3 | | MF: | C11H14N2OS | | MW: | 222.31 | | EINECS: | | | Product Categories: | Intermediates & Fine Chemicals;Metabolites & Impurities;Pharmaceuticals | | Mol File: | 32190-33-3.mol |  |
| Boiling point | 405.0±24.0 °C(Predicted) | | density | 1.181±0.06 g/cm3(Predicted) | | storage temp. | Hygroscopic, Refrigerator, under inert atmosphere | | solubility | Chloroform (Slightly), Methanol (Slightly) | | pka | 10.21±0.10(Predicted) | | form | Solid | | color | Colourless to Off-White | | Stability: | Air Sensitive, Hygroscopic | | InChI | InChI=1S/C11H14N2OS/c14-11-12-10(8-13(11)6-7-15)9-4-2-1-3-5-9/h1-5,10,15H,6-8H2,(H,12,14) | | InChIKey | KKEBXNMGHUCPEZ-UHFFFAOYSA-N | | SMILES | C1(=O)N(CCS)CC(C2=CC=CC=C2)N1 |
| Uses | Levamisole (L331100) metabolite. |
| | OMPI Preparation Products And Raw materials |
|