| Company Name: |
Nanjing XiZe Biotechnology CO., Ltd.
|
| Tel: |
025-66023220 15250997978 |
| Email: |
1511893459@qq.com |
| Products Intro: |
Product Name:Levamisole EP Impurity B
CAS:37430-07-2
Purity:95% HPLC Package:10mg;25mg;50mg;100mg;250mg;500mg;1g
|
| Company Name: |
Shanghai Rechem science Co., Ltd.
|
| Tel: |
021-31433387 15618786686 |
| Email: |
sales@rechemscience.com |
| Products Intro: |
Product Name:Levamisole EP Impurity B
CAS:37430-07-2
Purity:97% HPLC Package:50mg 100mg 500mg 1g
|
| Company Name: |
Shanghai Chaolan Chemical Technology Center
|
| Tel: |
QQ：65489617 19372819560 |
| Email: |
Sales@ATKchemical.com |
| Products Intro: |
Product Name:Levamisole EP Impurity B
CAS:37430-07-2
Purity:98 Package:1G,5G,10G,50G,100G,500G
|
|
| | Levamisole EP Impurity B Basic information |
| Product Name: | Levamisole EP Impurity B | | Synonyms: | Levamisole EP Impurity B;(E)-3-Styrylthiazolidin-2-imine;Levamisole Hydrochloride Impurity Ⅰ:Levamisole EP Impurity B;Levamisole Impurity 2（Levamisole EP Impurity B）;Levamisole EP Impurity BQ: What is
Levamisole EP Impurity B Q: What is the CAS Number of
Levamisole EP Impurity B;2-Thiazolidinimine, 3-(2-phenylethenyl)-, (,E)- (9CI);Lemomisole EP Impurity-B;Levamisole Hydrochloride Impurity Ⅰ:Levamisole EP Impurity B | | CAS: | 37430-07-2 | | MF: | C11H12N2S | | MW: | 204.29138 | | EINECS: | | | Product Categories: | | | Mol File: | 37430-07-2.mol |  |
| | Levamisole EP Impurity B Chemical Properties |
| Boiling point | 317.2±35.0 °C(Predicted) | | density | 1.16±0.1 g/cm3(Predicted) | | pka | 8.07±0.20(Predicted) | | InChI | InChI=1S/C11H12N2S/c12-11-13(8-9-14-11)7-6-10-4-2-1-3-5-10/h1-7,12H,8-9H2/b7-6+,12-11 | | InChIKey | VTWWXGPFQZXGGE-WQAKAUOBSA-N | | SMILES | S1CCN(/C=C/C2=CC=CC=C2)C1=N |
| | Levamisole EP Impurity B Usage And Synthesis |
| | Levamisole EP Impurity B Preparation Products And Raw materials |
|