| Company Name: |
T&W GROUP |
| Tel: |
021-61551611 13296011611 |
| Email: |
contact@trustwe.com |
illudin M manufacturers
- Illudin M
-
- $413.00
-
2026-05-06
- CAS:1146-04-9
- Purity: 99.56%
- Supply Ability: 10g
- illudin M
-
-
2025-12-24
- CAS:1146-04-9
- Min. Order: 1KG
- Purity: 99.0%
- Supply Ability: 10 tons
|
| | illudin M Basic information |
| Product Name: | illudin M | | Synonyms: | illudin M;(3S)-2,3-Dihydro-3α,6β-dihydroxy-2,2,4,6-tetramethylspiro[5H-indene-5,1'-cyclopropan]-7(6H)-one;(3'S,6'R)-2',3'-Dihydro-3',6'-dihydroxy-2',2',4',6'-tetramethylspiro[cyclopropane-1,5'-[5H]inden]-7'(6'H)-one;Spiro[cyclopropane-1,5'-[5H]inden]-7'(6'H)-one, 2',3'-dihydro-3',6'-dihydroxy-2',2',4',6'-tetramethyl-, (3'S,6'R)-;(3'S,6'R)-3',6'-dihydroxy-2',2',4',6'-tetramethyl-2',3',6',7'-tetrahydrospiro[cyclopropane-1,5'-inden]-7'-one | | CAS: | 1146-04-9 | | MF: | C15H20O3 | | MW: | 248.32 | | EINECS: | | | Product Categories: | ADC | | Mol File: | 1146-04-9.mol |  |
| | illudin M Chemical Properties |
| Melting point | 120-122.5° (Matsumoto); mp 128-130° (McMorris) | | Boiling point | 452.4±45.0 °C(Predicted) | | density | 1.24±0.1 g/cm3(Predicted) | | storage temp. | Store at -20°C | | solubility | DMF: Soluble; DMSO: Soluble; Ethanol: Soluble; Methanol: Soluble | | form | A solid | | pka | 12.57±0.70(Predicted) | | color | Off-white to light yellow | | InChI | InChI=1S/C15H20O3/c1-8-10-9(7-13(2,3)12(10)17)11(16)14(4,18)15(8)5-6-15/h7,12,17-18H,5-6H2,1-4H3/t12-,14+/m1/s1 | | InChIKey | QVMDIQLUNODCTG-OCCSQVGLSA-N | | SMILES | C12([C@](O)(C)C(=O)C3C(=C1C)[C@@H](O)C(C)(C)C=3)CC2 |
| | illudin M Usage And Synthesis |
| Description | Illudin M is a cytotoxic sesquiterpene from the fungus O. illudens that alkylates DNA. It is cytotoxic to HL-60 human leukemia cells at 6-100 nM. Illudin M was used as a base structure for the development of potential anticancer agents with less toxicity and improved efficacy. It is closely related to illudin S , which has been the focus of additional studies. | | Uses | Illudin M is a cytotoxic sesquiterpene from Omphalotus illudens and Granulobasidium vellereum. It acts as an alkylating agent that can cause inhibition of cell growth or replication. | | Definition | ChEBI: Illudin M is a sesquiterpenoid. | | References | [1] J. JACOBSON. Pharmacokinetics, Safety, and Antiviral Effects of Hypericin, a Derivative of St. John’s Wort Plant, in Patients with Chronic Hepatitis C Virus Infection[J]. Antimicrobial Agents and Chemotherapy, 2001, 45 1: 517-524. DOI: 10.1128/aac.45.2.517-524.2001
[2] M J KELNER. Preclinical evaluation of illudins as anticancer agents.[J]. Cancer research, 1987, 47 12: 3186-3189.
[3] R SCHOBERT. Anticancer active illudins: recent developments of a potent alkylating compound class.[J]. Current medicinal chemistry, 2011, 18 6: 790-807. DOI: 10.2174/092986711794927766 |
| | illudin M Preparation Products And Raw materials |
|