- Gomisin G
-
- $64.00
-
2026-07-27
- CAS:62956-48-3
- Purity: 99.98%
- Supply Ability: 10g
- Gomisin G
-
-
2023-02-24
- CAS:62956-48-3
- Min. Order: 5mg
- Purity: ≥98%(HPLC)
- Supply Ability: 10 g
- GOMISING
-
- $1.00
-
2019-07-06
- CAS:62956-48-3
- Min. Order: 1g
- Purity: 99%
- Supply Ability: 100KG
|
| | GOMISING Basic information |
| Product Name: | GOMISING | | Synonyms: | GOMISING;Benzo[3,4]cycloocta[1,2-f][1,3]benzodioxole-7,8-diol, 5,6,7,8-tetrahydro-1,2,3,13-tetramethoxy-6,7-dimethyl-, 8-benzoate, (6S,7S,8S,13aS)-;Gomisin G-RM;Gomisin G, 10 mM in DMSO | | CAS: | 62956-48-3 | | MF: | C30H32O9 | | MW: | 536.57 | | EINECS: | | | Product Categories: | | | Mol File: | 62956-48-3.mol |  |
| | GOMISING Chemical Properties |
| Boiling point | 670.9±55.0 °C(Predicted) | | density | 1.33±0.1 g/cm3 (20 ºC 760 Torr) | | storage temp. | Store at -20°C | | solubility | DMSO:50.0(Max Conc. mg/mL);93.18(Max Conc. mM) | | pka | 13.70±0.60(Predicted) | | form | powder | | color | White | | InChIKey | OFDWKHIQKPKRKY-HAILEXTNSA-N | | SMILES | O1COc2c1c(c3c(c2)C([C@]([C@H](Cc5c3c(c(c(c5)OC)OC)OC)C)(O)C)OC(=O)c4ccccc4)OC |
| WGK Germany | WGK 3 | | Storage Class | 11 - Combustible Solids |
| | GOMISING Usage And Synthesis |
| Chemical Properties | White crystalline powder, soluble in organic solvents such as methanol, ethanol, and DMSO, derived from Schisandra chinensis. | | Uses | Gomisin G is a drug candidate for the treatment of cardiovascular disease. UDP-glucuronosyltransferases inhibitor. |
| | GOMISING Preparation Products And Raw materials |
|