| Company Name: |
ChemPep, Inc. |
| Tel: |
+1 (888) 615-9178 / (561) 791-8787 |
| Email: |
service@chempep.com |
|
| | Fmoc-Lys(Trt)-OH Basic information |
| Product Name: | Fmoc-Lys(Trt)-OH | | Synonyms: | (S)-2-(((9H-fluoren-9-yl)methoxy)carbonylamino)-6-(tritylamino)hexanoic acid;N2-[(9H-Fluoren-9-ylmethoxy)carbonyl]-N6-(triphenylmethyl)-L-lysine;Nα-Fmoc-Nε-trityl-L-lysine≥ 99% (HPLC);(9H-Fluoren-9-yl)MethOxy]Carbonyl Lys(Trt)-OH;(2S)-2-({[(9H-fluoren-9-yl)methoxy]carbonyl}amino)-6-[(triphenylmethyl)amino]hexanoic acid;L-Lysine,N2-[(9H-fluoren-9-ylmethoxy)carbonyl]-N6-(triphenylmethyl)-;N2-(((9H-Fluoren-9-yl)methoxy)carbonyl)-N6-trityl-L-lysine;N2-Fmoc-N6-trityl-L-Lysine | | CAS: | 111061-54-2 | | MF: | C40H38N2O4 | | MW: | 610.74 | | EINECS: | | | Product Categories: | | | Mol File: | 111061-54-2.mol |  |
| | Fmoc-Lys(Trt)-OH Chemical Properties |
| Melting point | 145℃ | | Boiling point | 789.5±60.0 °C(Predicted) | | density | 1.208±0.06 g/cm3(Predicted) | | storage temp. | 2-8°C | | form | Solid | | pka | 3.83±0.21(Predicted) | | color | White to off-white | | Optical Rotation | 6.467°(C=0.01 g/mL CHCL3) | | InChIKey | CEOOTQDKDICVJW-QNGWXLTQSA-N | | SMILES | C(O)(=O)[C@H](CCCCNC(C1=CC=CC=C1)(C1=CC=CC=C1)C1=CC=CC=C1)NC(OCC1C2=C(C=CC=C2)C2=C1C=CC=C2)=O |
| | Fmoc-Lys(Trt)-OH Usage And Synthesis |
| Chemical Properties | White to off-white crystals | | Uses | N2-(((9H-Fluoren-9-yl)methoxy)carbonyl)-N6-trityl-L-lysine is a lysine derivative[1]. | | References | [1] Luckose F, et al. Effects of amino acid derivatives on physical, mental, and physiological activities. Crit Rev Food Sci Nutr. 2015;55(13):1793-1144. DOI:10.1080/10408398.2012.708368 |
| | Fmoc-Lys(Trt)-OH Preparation Products And Raw materials |
|