| Company Name: |
Energy Chemical |
| Tel: |
400-0056266 |
| Email: |
sales8178@energy-chemical.com |
|
| | 1-Bromo-2-methyl-4-(trifluoromethyl)benzene, 2-bromo-5-trifluoromethyltoluene Basic information |
| | 1-Bromo-2-methyl-4-(trifluoromethyl)benzene, 2-bromo-5-trifluoromethyltoluene Chemical Properties |
| Boiling point | 199.4±35.0 °C(Predicted) | | density | 1.538±0.06 g/cm3(Predicted) | | storage temp. | Sealed in dry,Room Temperature | | form | liquid | | color | Clear, colourless | | InChI | InChI=1S/C8H6BrF3/c1-5-4-6(8(10,11)12)2-3-7(5)9/h2-4H,1H3 | | InChIKey | NXHNLJDFFBZSKJ-UHFFFAOYSA-N | | SMILES | C1(Br)=CC=C(C(F)(F)F)C=C1C |
| Hazard Codes | Xi | | HazardClass | IRRITANT | | HS Code | 2903998090 |
| | 1-Bromo-2-methyl-4-(trifluoromethyl)benzene, 2-bromo-5-trifluoromethyltoluene Usage And Synthesis |
| | 1-Bromo-2-methyl-4-(trifluoromethyl)benzene, 2-bromo-5-trifluoromethyltoluene Preparation Products And Raw materials |
|