|
|
| | 1-(2-hydroxy-3-methoxy-phenyl)ethanone Basic information |
| Product Name: | 1-(2-hydroxy-3-methoxy-phenyl)ethanone | | Synonyms: | 1-(2-hydroxy-3-methoxy-phenyl)ethanone;Acetophenone, 2-hydroxy-3'-methoxy-;Nsc 46634;Ethanone, 1-(2-hydroxy-3-Methoxyphenyl)-;2'-Hydroxy-3'-methoxyacetophenone;-(2-hydroxy-3-methoxy-phenyl)ethanone;Resorcinol Impurity 63;1-(2-hydroxy-3-Methoxyphenyl)ethan-1-one | | CAS: | 703-98-0 | | MF: | C9H10O3 | | MW: | 166.17 | | EINECS: | | | Product Categories: | | | Mol File: | 703-98-0.mol |  |
| | 1-(2-hydroxy-3-methoxy-phenyl)ethanone Chemical Properties |
| Melting point | 54 °C | | Boiling point | 247.2±20.0 °C(Predicted) | | density | 1.158±0.06 g/cm3(Predicted) | | storage temp. | under inert gas (nitrogen or Argon) at 2-8°C | | solubility | Chloroform (Slightly), DMSO (Slightly), Methanol (Slightly) | | form | Solid | | pka | 10.17±0.10(Predicted) | | color | Pale Yellow to Light Yellow | | InChI | InChI=1S/C9H10O3/c1-6(10)7-4-3-5-8(12-2)9(7)11/h3-5,11H,1-2H3 | | InChIKey | VZEOJJIAYZCDPI-UHFFFAOYSA-N | | SMILES | C(=O)(C1=CC=CC(OC)=C1O)C |
| | 1-(2-hydroxy-3-methoxy-phenyl)ethanone Usage And Synthesis |
| Uses | 2''-Hydroxy-3''-methoxyacetophenone, is an intermediate used for he synthesis of various chemical compounds. It can be used for the synthesis of 4''-Hydroxy-3-methoxyflavones with potent antipicornavirus activity. | | Preparation | Preparation from 2,3-dimethoxybenzonitrile and methyl-magnesium iodide in refluxing ethyl ether (Grignard reaction) (75%). |
| | 1-(2-hydroxy-3-methoxy-phenyl)ethanone Preparation Products And Raw materials |
|