|
|
| | 2-METHOXYPHENYL ACETATE Basic information |
| Product Name: | 2-METHOXYPHENYL ACETATE | | Synonyms: | Phenol,2-methoxy-,acetate;2-METHOXYPHENYL ACETATE 98+%;Acetic acid o-methoxyphenyl ester;Acetic Acid 2-Methoxyphenyl Ester
2-Guaiacol Acetate
Acetic Acid 2-Guaiacol Ester
O-Acetylguaiacol;ACETIC ACID 2-METHOXYPHENYL ESTER;ACETIC ACID 2-GUAIACOL ESTER;2-GUAIACOL ACETATE;2-METHOXYPHENYL ACETATE | | CAS: | 613-70-7 | | MF: | C9H10O3 | | MW: | 166.17 | | EINECS: | 210-350-8 | | Product Categories: | Aromatic Esters | | Mol File: | 613-70-7.mol |  |
| | 2-METHOXYPHENYL ACETATE Chemical Properties |
| Melting point | 31.5°C | | Boiling point | 122-124 °C18 mm Hg(lit.) | | density | 1.129 g/mL at 25 °C(lit.) | | refractive index | n20/D 1.514(lit.) | | FEMA | 3687 | GUAIACYL ACETATE | | Fp | >230 °F | | storage temp. | Store at room temperature | | form | clear liquid | | color | Colorless to Almost colorless | | Specific Gravity | 1.141.129 | | Odor | at 100.00 %. sweet woody spice dry clove powdery smoky | | Odor Type | woody | | JECFA Number | 718 | | Cosmetics Ingredients Functions | PERFUMING | | InChI | InChI=1S/C9H10O3/c1-7(10)12-9-6-4-3-5-8(9)11-2/h3-6H,1-2H3 | | InChIKey | BHJHPYFAYGAPLS-UHFFFAOYSA-N | | SMILES | C1(OC(=O)C)=CC=CC=C1OC | | LogP | 1.38 | | EPA Substance Registry System | o-Methoxyphenyl acetate (613-70-7) |
| WGK Germany | 3 | | TSCA | TSCA listed | | HazardClass | IRRITANT | | HS Code | 29153900 |
| | 2-METHOXYPHENYL ACETATE Usage And Synthesis |
| Description | Guaiacyl acetate has an odor similar to that of guaiacol. It may
be synthesized from guaiacol and excess acetic anhydride in the
presence of trace amounts of H2S04. | | Chemical Properties | Guaiacyl acetate has an odor similar to that of guaiacol. | | Occurrence | Reported found in cocoa | | Definition | ChEBI: Guaicyl acetate is a benzoate ester and a member of phenols. | | Preparation | From guaiacol and excess acetic anhydride in the presence of trace amounts of H2SO4. | | Aroma threshold values | Aroma characteristics at 5.0%: phenolic, guaiacol, smoky and harm-like with a woody, vanilla nuance. | | Taste threshold values | Taste characteristics at 50 ppm: woody, guaiacol, smoky, astringent and phenolic with vanillin and couma- rin nuances. |
| | 2-METHOXYPHENYL ACETATE Preparation Products And Raw materials |
|