- 4-HYDROXYESTRADIOL
-
- $1.00 / 1kg
-
2019-07-06
- CAS:5976-61-4
- Min. Order: 1kg
- Purity: 95%-99%
- Supply Ability: 100kg
|
| | 4-HYDROXYESTRADIOL Basic information |
| Product Name: | 4-HYDROXYESTRADIOL | | Synonyms: | 3,4,17BETA-TRIHYDROXY-1,3,5[10]-ESTRATRIENE;1,3,5[10]-ESTRATRIENE-3,4,17BETA-TRIOL;1,3,5(10)-ESTRATRIEN-3,4,17-BETA-TRIOL;4-HYDROXY 17-BETA-ESTRADIOL;4-HYDROXYESTRADIOL;4-hydroxyestradiol-17beta;4-oh-estradiol;estra-1,3,5(10)-triene-3,4,17-beta-triol | | CAS: | 5976-61-4 | | MF: | C18H24O3 | | MW: | 288.38 | | EINECS: | | | Product Categories: | Metabolites & Impurities;Steroids | | Mol File: | 5976-61-4.mol |  |
| | 4-HYDROXYESTRADIOL Chemical Properties |
| Melting point | >210°C (dec.) | | Boiling point | 370.61°C (rough estimate) | | density | 1.1285 (rough estimate) | | refractive index | 1.5000 (estimate) | | storage temp. | −20°C | | solubility | Ethanol (Slightly, Heated), Ethyl Acetate (Slightly, Heated), Methanol (Slightly | | form | Solid | | pka | 10.07±0.60(Predicted) | | color | Light Yellow to Light Beige | | Stability: | Hygroscopic | | InChI | 1S/C18H24O3/c1-18-9-8-11-10-4-6-15(19)17(21)13(10)3-2-12(11)14(18)5-7-16(18)20/h4,6,11-12,14,16,19-21H,2-3,5,7-9H2,1H3/t11-,12-,14+,16+,18+/m1/s1 | | InChIKey | QOZFCKXEVSGWGS-ZHIYBZGJSA-N | | SMILES | [H][C@]12CC[C@]3(C)[C@@H](O)CC[C@@]3([H])[C@]1([H])CCc4c(O)c(O)ccc24 |
| Hazard Codes | Xn | | Risk Statements | 40 | | Safety Statements | 22-36 | | WGK Germany | 3 | | RTECS | KG7676000 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Carc. 2 |
| | 4-HYDROXYESTRADIOL Usage And Synthesis |
| Chemical Properties | Light Brown Solid | | Uses | A metabolite of Estradiol. | | Definition | ChEBI: A 4-hydroxy steroid that consists of 17beta-estradiol having an additional hydroxy group at position 4. |
| | 4-HYDROXYESTRADIOL Preparation Products And Raw materials |
|