| Company Name: |
SPIRO PHARMA |
| Tel: |
|
| Email: |
eric_feng1954@126.com |
|
| | 3,3-Dimethyl-4-oxo-piperidine-1-carboxylic acid benzyl ester Basic information |
| | 3,3-Dimethyl-4-oxo-piperidine-1-carboxylic acid benzyl ester Chemical Properties |
| Boiling point | 388.1±42.0 °C(Predicted) | | density | 1.132±0.06 g/cm3(Predicted) | | storage temp. | Inert atmosphere,Room Temperature | | pka | -1.56±0.40(Predicted) | | form | solid | | Appearance | Colorless to light yellow Liquid | | InChI | 1S/C15H19NO3/c1-15(2)11-16(9-8-13(15)17)14(18)19-10-12-6-4-3-5-7-12/h3-7H,8-11H2,1-2H3 | | InChIKey | QHCSLEQTUOGKAJ-UHFFFAOYSA-N | | SMILES | O=C(OCC1=CC=CC=C1)N2CC(C)(C)C(CC2)=O |
| Storage Class | 11 - Combustible Solids | | Hazard Classifications | Acute Tox. 4 Oral |
| | 3,3-Dimethyl-4-oxo-piperidine-1-carboxylic acid benzyl ester Usage And Synthesis |
| Synthesis | The general procedure for the synthesis of benzyl 3,3-dimethyl-4-oxopiperidine-1-carboxylate from 3,3-dimethylpiperidin-4-one hydrochloride and benzyl chloroformate was as follows: sodium bicarbonate (1.28 g, 15.28 mmol, 2.50 eq.) and benzyl chloroformate (1.25 g, 7.33 mmol, 1.20 eq.) were sequentially added to tetrahydrofuran (5.00 mL) and water (5.00 mL) at 0 °C containing 3,3 -dimethylpiperidin-4-one hydrochloride (1.00 g, 6.11 mmol, 1.00 equiv) in a mixed solution of tetrahydrofuran (5.00 mL) and water (5.00 mL). The reaction mixture was stirred at 15 °C for 12 hours. Upon completion of the reaction, the reaction mixture was extracted with ethyl acetate (20 mL). The organic layers were combined, washed with brine (10 mL x 2), dried over anhydrous sodium sulfate, filtered and concentrated under reduced pressure to afford benzyl 3,3-dimethyl-4-oxopiperidine-1-carboxylate (1.60 g, 4.81 mmol, 78.66% yield) as a colorless oil with 78.5% purity. The product was characterized by 1H NMR (400 MHz, CDCl3): δ 7.35-7.25 (m, 6H), 5.11 (s, 2H), 3.72 (t, J = 6.3 Hz, 2H), 3.42 (br.s., 2H), 2.44 (br.s., 2H), 1.02 (br.s., 6H). | | References | [1] Patent: EP3252059, 2017, A1. Location in patent: Paragraph 0530; 0535; 0536 [2] Patent: WO2017/189386, 2017, A1. Location in patent: Page/Page column 44 [3] Patent: WO2018/136887, 2018, A1. Location in patent: Page/Page column 154; 155 |
| | 3,3-Dimethyl-4-oxo-piperidine-1-carboxylic acid benzyl ester Preparation Products And Raw materials |
|