|
|
| | 1-Cbz-4-Piperidone Basic information |
| | 1-Cbz-4-Piperidone Chemical Properties |
| Melting point | 38-41°C | | Boiling point | 114-140 °C/0.25 mmHg (lit.) | | density | 1.172 g/mL at 25 °C (lit.) | | refractive index | n20/D 1.542(lit.) | | Fp | >110 °C | | storage temp. | Sealed in dry,2-8°C | | solubility | Chloroform, Dichloromethane, Ethyl Acetate, Methanol | | pka | -1.63±0.20(Predicted) | | form | Solid or Lliquid | | Specific Gravity | 1.185 | | color | White to pale yellow | | BRN | 1533716 | | InChI | InChI=1S/C13H15NO3/c15-12-6-8-14(9-7-12)13(16)17-10-11-4-2-1-3-5-11/h1-5H,6-10H2 | | InChIKey | VZOVOHRDLOYBJX-UHFFFAOYSA-N | | SMILES | N1(C(OCC2=CC=CC=C2)=O)CCC(=O)CC1 | | CAS DataBase Reference | 19099-93-5(CAS DataBase Reference) |
| Hazard Codes | Xi | | Risk Statements | 36/37/38 | | Safety Statements | 23-24/25-36-26-37/39 | | WGK Germany | 3 | | HS Code | 29333990 | | Storage Class | 10 - Combustible liquids | | Hazard Classifications | Acute Tox. 4 Oral Aquatic Chronic 3 |
| | 1-Cbz-4-Piperidone Usage And Synthesis |
| Chemical Properties | Colourless Oil | | Uses | Protected piperidinone that can undergo interesting synthetic transformations including the Knoevenagel reaction,1 hetero-Diels-Alder reactions,2 and reactions to form N-(4-piperidinyl)oxindoles.3 | | General Description | 1-Cbz-4-Piperidone is the starting material in biheteroaromatic diphosphine oxides-catalyzed stereoselective direct aldol condensation reactions. |
| | 1-Cbz-4-Piperidone Preparation Products And Raw materials |
|