|
| 4-Nitrobenzyl 2-diazoacetoacetate Basic information |
Product Name: | 4-Nitrobenzyl 2-diazoacetoacetate | Synonyms: | p-Nitrobenzyl 2-diazoacetoacetate;p-Nitrobenzyl-diazoacetoacetate;4-Nitrobenzyl 2-diazoacetoacetate;2-diazo-5-(4-nitrophenyl)-3-oxopentanoate;Butanoic acid,2-diazo-3-oxo-, (4-nitrophenyl)Methyl ester;4-nitrobenzyl 2-diazo-3-oxobutanoate;p-Nitrobenzyl -diazoacetoacetate: p-Nitrobenzyl 2-diazoacetoacetate;2-diazonio-5-(4-nitrophenyl)-3-oxo-1-pentene-1,1-diolate | CAS: | 82551-63-1 | MF: | C11H9N3O5 | MW: | 263.21 | EINECS: | 1806241-263-5 | Product Categories: | pharmaceutical intermediates | Mol File: | 82551-63-1.mol |  |
| 4-Nitrobenzyl 2-diazoacetoacetate Chemical Properties |
solubility | DMSO (Slightly), Methanol (Slightly) | form | Solid | color | Pale Yellow to Light Yellow | InChI | InChI=1S/C11H9N3O5/c1-7(15)10(13-12)11(16)19-6-8-2-4-9(5-3-8)14(17)18/h2-5H,6H2,1H3 | InChIKey | HEKGSEIAAGMGPL-UHFFFAOYSA-N | SMILES | C(=[N+]=[N-])(C(=O)C)C(=O)OCC1C=CC(N(=O)=O)=CC=1 | CAS DataBase Reference | 82551-63-1(CAS DataBase Reference) |
| 4-Nitrobenzyl 2-diazoacetoacetate Usage And Synthesis |
Chemical Properties | The substance is characterized as a white or nearly white powder, which can range to a light yellow shade. | Synthesis | The invention presents a method for preparing p-nitrobenzyl 2-diazoacetoacetate through a two-step reaction process. This method offers numerous benefits, such as streamlined processing steps, easier industrial production, reduced production costs, enhanced product quality, and increased yield. Using nitrobenzyl alcohol as a standard, the overall mol yield achieves 95% or more, and the purity of the product compound (IV) reaches at least 99.5%. CN101983958A/en |
| 4-Nitrobenzyl 2-diazoacetoacetate Preparation Products And Raw materials |
|