|
|
| | 4'-CHLORO[1,1'-BIPHENYL]-4-SULFONYL CHLORIDE Basic information |
| | 4'-CHLORO[1,1'-BIPHENYL]-4-SULFONYL CHLORIDE Chemical Properties |
| Melting point | 109 °C | | Boiling point | 400.8±28.0 °C(Predicted) | | density | 1.412±0.06 g/cm3(Predicted) | | Sensitive | Moisture Sensitive | | InChI | InChI=1S/C12H8Cl2O2S/c13-11-5-1-9(2-6-11)10-3-7-12(8-4-10)17(14,15)16/h1-8H | | InChIKey | NWYUSJMIHFIMTA-UHFFFAOYSA-N | | SMILES | C1(C2=CC=C(Cl)C=C2)=CC=C(S(Cl)(=O)=O)C=C1 | | CAS DataBase Reference | 20443-74-7(CAS DataBase Reference) |
| Hazard Codes | C | | Risk Statements | 14-34 | | Safety Statements | 26-36/37/39-45 | | RIDADR | UN 3261 8 / PGII | | WGK Germany | 3 | | Hazard Note | Irritant | | HazardClass | 8 | | HS Code | 2904990090 |
| | 4'-CHLORO[1,1'-BIPHENYL]-4-SULFONYL CHLORIDE Usage And Synthesis |
| | 4'-CHLORO[1,1'-BIPHENYL]-4-SULFONYL CHLORIDE Preparation Products And Raw materials |
|