|
|
| | Ethyl 2-aminopyrimidine-5-carboxylate Basic information |
| | Ethyl 2-aminopyrimidine-5-carboxylate Chemical Properties |
| Boiling point | 344.2±34.0 °C(Predicted) | | density | 1.319 | | storage temp. | under inert gas (nitrogen or Argon) at 2–8 °C | | form | solid | | pka | 1.83±0.10(Predicted) | | Appearance | Light yellow to yellow Solid | | InChI | InChI=1S/C6H7N3O2/c1-11-5(10)4-2-8-6(7)9-3-4/h2-3H,1H3,(H2,7,8,9) | | InChIKey | JVHBXKOTWYZYDF-UHFFFAOYSA-N | | SMILES | C1(N)=NC=C(C(OC)=O)C=N1 |
| WGK Germany | WGK 3 | | HazardClass | IRRITANT | | HS Code | 2933599590 | | Storage Class | 11 - Combustible Solids |
| | Ethyl 2-aminopyrimidine-5-carboxylate Usage And Synthesis |
| | Ethyl 2-aminopyrimidine-5-carboxylate Preparation Products And Raw materials |
|