- Cbz-L-Ile-OH
-
- $0.00/ kg
-
2026-03-17
- CAS:3160-59-6
- Min. Order: 1kg
- Purity: 95%
- Supply Ability: 1T+
- N-Cbz-L-Isoleucine
-
- $0.00 / 1KG
-
2026-03-17
- CAS:3160-59-6
- Min. Order: 500g
- Purity: 99.0%
- Supply Ability: 50kg/month
- Cbz-L-Ile-OH
-
- $50.00 / 1kg
-
2025-05-23
- CAS:3160-59-6
- Min. Order: 1kg
- Purity: 99
- Supply Ability: 5000
|
| | N-Cbz-L-Isoleucine Basic information |
| | N-Cbz-L-Isoleucine Chemical Properties |
| Melting point | 52-54 °C(lit.) | | alpha | 7 º (c=6, EtOH) | | Boiling point | 408.52°C (rough estimate) | | density | 1.1356 (rough estimate) | | refractive index | 6.5 ° (C=6, EtOH) | | storage temp. | 2-8°C | | solubility | DMSO (Slightly), Ethanol (Sparingly), Methanol (Sparingly) | | pka | 4.02±0.22(Predicted) | | form | Off-White Semi-Solid | | color | White or Colorless to Almost white or Almost colorless | | Optical Rotation | [α]20/D +6.0°, c = 6 in ethanol | | BRN | 4189486 | | Major Application | peptide synthesis | | InChI | InChI=1S/C14H19NO4/c1-3-10(2)12(13(16)17)15-14(18)19-9-11-7-5-4-6-8-11/h4-8,10,12H,3,9H2,1-2H3,(H,15,18)(H,16,17)/t10-,12-/m0/s1 | | InChIKey | JSHXJPFZKBRLFU-JQWIXIFHSA-N | | SMILES | C(O)(=O)[C@H]([C@@H](C)CC)NC(OCC1=CC=CC=C1)=O | | CAS DataBase Reference | 3160-59-6(CAS DataBase Reference) |
| | N-Cbz-L-Isoleucine Usage And Synthesis |
| Chemical Properties | white to yellowish weak solid | | Uses | N-Cbz-L-isoleucine is an N-Cbz-protected form of L-Isoleucine (I820175). L-Isoleucine is classified as an essential amino acid, and is also a tumour promoter of bladder cancer in rats. | | reaction suitability | reaction type: solution phase peptide synthesis |
| | N-Cbz-L-Isoleucine Preparation Products And Raw materials |
|