| Company Name: |
Energy Chemical |
| Tel: |
400-0056266 |
| Email: |
sales8178@energy-chemical.com |
| Company Name: |
Sigma-Aldrich |
| Tel: |
021-61415566 800-8193336 |
| Email: |
orderCN@merckgroup.com |
|
| | (+)-Menthoxyacetic acid Basic information |
| | (+)-Menthoxyacetic acid Chemical Properties |
| Boiling point | 163-164 °C/10 mmHg (lit.) | | density | 1.02 g/mL at 25 °C (lit.) | | refractive index | n20/D 1.465(lit.) | | Fp | >230 °F | | pka | 3.47±0.10(Predicted) | | Optical Rotation | [α]20/D +92.5°, c = 10 in ethanol | | BRN | 3198466 | | InChI | 1S/C12H22O3/c1-8(2)10-5-4-9(3)6-11(10)15-7-12(13)14/h8-11H,4-7H2,1-3H3,(H,13,14)/t9-,10+,11-/m0/s1 | | InChIKey | CILPHQCEVYJUDN-AXFHLTTASA-N | | SMILES | CC(C)[C@H]1CC[C@H](C)C[C@@H]1OCC(O)=O |
| Hazard Codes | Xi | | Risk Statements | 36/37/38 | | Safety Statements | 26-36 | | WGK Germany | 3 | | Storage Class | 10 - Combustible liquids | | Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |
| | (+)-Menthoxyacetic acid Usage And Synthesis |
| | (+)-Menthoxyacetic acid Preparation Products And Raw materials |
|