|
|
| | 3-(2-THIENYL)ACRYLIC ACID Basic information |
| | 3-(2-THIENYL)ACRYLIC ACID Chemical Properties |
| Melting point | 145-148 °C(lit.) | | Boiling point | 298.9±15.0 °C(Predicted) | | density | 1.346±0.06 g/cm3(Predicted) | | storage temp. | Inert atmosphere,Room Temperature | | solubility | DMSO, Methanol | | form | Solid | | pka | 4.34±0.10(Predicted) | | color | Yellow | | InChI | InChI=1S/C7H6O2S/c8-7(9)4-3-6-2-1-5-10-6/h1-5H,(H,8,9) | | InChIKey | KKMZQOIASVGJQE-UHFFFAOYSA-N | | SMILES | C(O)(=O)C=CC1SC=CC=1 | | CAS DataBase Reference | 1124-65-8(CAS DataBase Reference) |
| Hazard Codes | Xi | | Risk Statements | 36/37/38 | | Safety Statements | 26-36/37 | | WGK Germany | 3 | | HazardClass | IRRITANT | | HS Code | 2934999090 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Eye Irrit. 2
Skin Irrit. 2
STOT SE 3 |
| | 3-(2-THIENYL)ACRYLIC ACID Usage And Synthesis |
| Chemical Properties | Yellow Solid | | Uses | 3-(2-Thienyl)acrylic Acid is used as a phenylalanine derivative which shows improved intestinal absorption of insulin in mice. In addition it has been used in the synthesis of novel benzothiazepinones as glycogen synthase kinase-3β inhibitors. | | Definition | ChEBI: 2-Thiopheneacrylic acid is a heteroarene. |
| | 3-(2-THIENYL)ACRYLIC ACID Preparation Products And Raw materials |
|