- 1,2-DICHLOROBENZENE-D4
-
- $2037.00 / 100g
-
2026-03-27
- CAS:2199-69-1
- Min. Order: 1g
- Purity: 0.98
- Supply Ability: 25kg
- 1,2-DICHLOROBENZENE-D4
-
- $33.00 / 1kg
-
2025-09-25
- CAS:2199-69-1
- Min. Order: 1kg
- Purity: 99%
- Supply Ability: g-kg-tons, free sample is available
|
| | 1,2-DICHLOROBENZENE-D4 Basic information |
| Product Name: | 1,2-DICHLOROBENZENE-D4 | | Synonyms: | (2H4)-1,2-Phenylene dichloride;1,2-Dichloro(3,4,5,6-2H4)benzene;5,6-Dichloro(1,2,3,4-2H4)benzene;1,2-Dichlorobenzene-d, 99% (Isotopic);1,2-DICHLOROBENZENE-D4, 1X1ML, CH2CL2, 2 000UG/ML;1,2-DICHLOROBENZENE-D4, 250MG, NEAT;1,3-DICHLOROBENZENE, 1X1ML, MEOH, 200UG/ ML;1,3-DICHLOROBENZENE, 1X1ML, MEOH, 5000UG /ML | | CAS: | 2199-69-1 | | MF: | C6H4Cl2 | | MW: | 147 | | EINECS: | 218-606-0 | | Product Categories: | DIA - DIC;500 Series Drinking Water Methods;EPA;Method 524;Alphabetic;D | | Mol File: | 2199-69-1.mol |  |
| | 1,2-DICHLOROBENZENE-D4 Chemical Properties |
| Melting point | -17 °C (lit.) | | Boiling point | 178-180 °C (lit.) | | Boiling point | 178-180°C | | density | 1.341 g/mL at 25 °C (lit.) | | density | d = 1,34 | | refractive index | n20/D 1.5509(lit.) | | Fp | 150 °F | | storage temp. | 0-6°C | | solubility | Acetone (Soluble), Chloroform (Slightly) | | form | Liquid | | color | Clear colorless | | explosive limit | 2.2-12%(V) | | Water Solubility | Insoluble in water | | BRN | 1950096 | | InChI | InChI=1S/C6H4Cl2/c7-5-3-1-2-4-6(5)8/h1-4H | | InChIKey | RFFLAFLAYFXFSW-UHFFFAOYSA-N | | SMILES | ClC1C([H])=C([H])C([H])=C([H])C=1Cl | | CAS DataBase Reference | 2199-69-1(CAS DataBase Reference) | | EPA Substance Registry System | 1,2-Dichlorobenzene-d4 (2199-69-1) |
| | 1,2-DICHLOROBENZENE-D4 Usage And Synthesis |
| Chemical Properties | clear colorless liquid | | Uses | Isotope labelled 1,2-Dichlorobenzene is a side product of the production of chlorobenzene. | | Uses | It is applied in NMR spectroscopy. | | General Description | 1,2-Dichlorobenzene-d4 is a deuterated NMR solvent that is useful in NMR-based research and analyses. |
| | 1,2-DICHLOROBENZENE-D4 Preparation Products And Raw materials |
|