|
|
| | 2,4-Dichloronitrobenzene Basic information |
| | 2,4-Dichloronitrobenzene Chemical Properties |
| Melting point | 29-32 °C(lit.) | | Boiling point | 258 °C(lit.) | | density | 1.479 | | vapor pressure | 0.013 hPa (20 °C) | | refractive index | 1.5512 (estimate) | | Fp | >230 °F | | storage temp. | Store below +30°C. | | solubility | 188g/l | | form | Crystalline Low Melting Solid | | color | Yellow-brown | | Water Solubility | 188 mg/L (20 ºC) | | BRN | 1451655 | | Henry's Law Constant | 3.1×10-1 mol/(m3Pa) at 25℃, HSDB (2015) | | Stability: | Stable. Combustible. Incompatible with strong oxidizing agents, strong bases. | | InChI | 1S/C6H3Cl2NO2/c7-4-1-2-6(9(10)11)5(8)3-4/h1-3H | | InChIKey | QUIMTLZDMCNYGY-UHFFFAOYSA-N | | SMILES | [O-][N+](=O)c1ccc(Cl)cc1Cl | | CAS DataBase Reference | 611-06-3(CAS DataBase Reference) | | IARC | 2B (Vol. 123) 2020 | | NIST Chemistry Reference | Benzene, 2,4-dichloro-1-nitro-(611-06-3) | | EPA Substance Registry System | 2,4-Dichloronitrobenzene (611-06-3) |
| Hazard Codes | Xi,N,Xn | | Risk Statements | 36/37/38-51/53-43-21/22 | | Safety Statements | 26-36-61-36/37-24 | | RIDADR | 2811 | | WGK Germany | 3 | | RTECS | CZ5420000 | | Autoignition Temperature | 500 °C | | TSCA | TSCA listed | | HazardClass | 9 | | PackingGroup | III | | HS Code | 29049085 | | Storage Class | 6.1C - Combustible acute toxic Cat.3 toxic compounds or compounds which causing chronic effects | | Hazard Classifications | Acute Tox. 3 Dermal Acute Tox. 4 Oral Aquatic Chronic 2 Carc. 1B Muta. 2 Skin Sens. 1B | | Hazardous Substances Data | 611-06-3(Hazardous Substances Data) | | Toxicity | LD50 orally in Rabbit: 380 mg/kg LD50 dermal Rat 920 mg/kg |
| | 2,4-Dichloronitrobenzene Usage And Synthesis |
| Chemical Properties | yellow crystals | | Uses | 2,4-Dichloro-1-nitrobenzene is used as a reagent in the synthesis of the hepatitis C virus polymerase inhibitor, Deleobuvir (BI 207127). | | Production Methods | 1,3-Dichlorobenzene is nitrated with mixed acid, and the product 2,4-Dichloronitrobenzene is separated from the resulting isomer mixture. | | General Description | Light yellow needles or amber crystalline solid. | | Air & Water Reactions | Insoluble in water. | | Reactivity Profile | Can react vigorously with oxidizing materials. | | Fire Hazard | 2,4-Dichloronitrobenzene is combustible. |
| | 2,4-Dichloronitrobenzene Preparation Products And Raw materials |
|