| Company Name: |
BOC Sciences |
| Tel: |
1-631-485-4226; 16314854226 |
| Email: |
info@bocsci.com |
- Latrunculin B
-
- $679.00
-
2026-07-17
- CAS:76343-94-7
- Purity:
- Supply Ability: 10g
|
| | LATRUNCULIN B Basic information |
| Product Name: | LATRUNCULIN B | | Synonyms: | LATRUNCULIN B;LATRUNCULIN B, LATRUNCULIA MAGNIFICA;LatrunculinBfromLutrunculiamagnifica;LATRUNCULIN B, LUTRUNCULIA MAGNIFICA;NSC 339663;(4R)-[(1R,4Z,8Z,10S,13R,15R)-15-hydroxy-5,10-dimethyl-3-oxo-2,14-dioxabicyclo[11.3.1]heptadeca-4,8-dien-15-yl]-2-thiazolidinone;Latrunculin B, Latrunculia magnifica - CAS 76343-94-7 - Calbiochem;Latrunculin B from Latruncula magnifica | | CAS: | 76343-94-7 | | MF: | C20H29NO5S | | MW: | 395.51 | | EINECS: | | | Product Categories: | | | Mol File: | 76343-94-7.mol |  |
| | LATRUNCULIN B Chemical Properties |
| alpha | D24 +112° (c = 0.48 in chloroform) | | storage temp. | -20°C | | solubility | DMSO: soluble | | form | solid | | color | light yellow | | Optical Rotation | +120.123 (CHCl3) | | Stability: | Stable for 1 year from date of purchase as supplied. Solutions in DMSO or ethanol may be stored at -20° for up to 3 months. | | InChIKey | NSHPHXHGRHSMIK-JRIKCGFMSA-N | | SMILES | C[C@H]1CC[C@@H]2C[C@H](C[C@@](O)(O2)[C@@H]3CSC(=O)N3)OC(=O)C=C(C)CCC=C1 |
| WGK Germany | 3 | | Storage Class | 11 - Combustible Solids |
| | LATRUNCULIN B Usage And Synthesis |
| Description | Latrunculin B (76343-94-7) inhibits actin polymerization and disrupts microfilament organization.1 Significantly more potent than cytochalasins in the disruption of microfilament mediated processes2, causes shortening and thickening of stress fibers. Active in cell culture.3,4Effective doses for latrunculin B vary depending upon cell type but are frequently in the low micromolar range. Note: Latrunculin B is slowly inactivated by fetal bovine serum. | | Uses | In elucidation of molecular mechanisms of motile processes. | | Uses | Latrunculin B is an actin polymerization inhibitor. | | Uses | Latrunculin B from Latruncula magnifica has been used for actin depolymerisation in various experiments. It has also been used as a component in bone marrow-derived dendritic cell (BMDC) complete medium, to study the formation of tubules from phagosomes in dendritic cells. | | Definition | ChEBI: A macrolide consisting of a 14-membered bicyclic lactone attached to the rare 2-thiazolidinone moiety. It is obtained from the Red Sea sponge Latrunculia magnifica. | | General Description | Latrunculin B is a macrocyclic toxin, which is produced by Latruncula magnifica. | | Biochem/physiol Actions | Primary TargetActin polymerization | | storage | Store at -20°C | | References | [1] MARTINE COUÉ . Inhibition of actin polymerization by latrunculin A[J]. FEBS Letters, 1987, 213 2: Pages 316-318. DOI:10.1016/0014-5793(87)81513-2
[2] ILAN SPECTOR. Latrunculins—novel marine macrolides that disrupt microfilament organization and affect cell growth: I. Comparison with cytochalasin D[J]. Cytoskeleton, 1989, 13 3: 127-144. DOI:10.1002/cm.970130302
[3] Effects of cytochalasin D and latrunculin B on mechanical properties of cells
[4] BOYOUNG CHA. The lateral mobility of NHE3 on the apical membrane of renal epithelial OK cells is limited by the PDZ domain proteins NHERF1/2, but is dependent on an intact actin cytoskeleton as determined by FRAP.[J]. Journal of cell science, 2004, 117 Pt 15: 3353-3365. DOI:10.1242/jcs.01180
[5] HERRERA F. Cell cultures, transfection and treatments v1[J]. protocols.io, 2021, 21 1. DOI:10.17504/protocols.io.77ehrje |
| | LATRUNCULIN B Preparation Products And Raw materials |
|