|
| (-)-1,4-DI-O-TOSYL-2,3-O-ISOPROPYLIDENETHREITOL Basic information |
Product Name: | (-)-1,4-DI-O-TOSYL-2,3-O-ISOPROPYLIDENETHREITOL | Synonyms: | trans-(-)-1,4-Di-O-tosyl-2,3-O-isopropylidene-L-threitol,97%;(2S,3S)-1,4-Di-O-tosyl-2,3-O-isopropylidene-L-threitol;(4S,5S)-(+)-O-ISOPROPYLIDENE-2,3-DIHYDROXY-1,4-BIS(P-TOSYL)BUTANE;(4S,5S)-(-)-4,5-BIS(TOSYLOXYMETHYL)-2,2-DIMETHYL-1,3-DIOXOLANE;(4S,5S)-4,5-BIS(TOSYLOXYMETHYL)-2,2-DIMETHYL-1,3-DIOXOLANE;(4R,5R)-(-)-O-ISOPROPYLIDENE-2,3-DIHYDROXY-1,4-BIS(P-TOSYL)BUTANE;(-)-1,4-Ditosyl-2,3,O-isopropylidene-L-threitol;(-)-2,3-O-Isopropylidene-1,4-di-O-tosyl-L-threitol | CAS: | 37002-45-2 | MF: | C21H26O8S2 | MW: | 470.56 | EINECS: | 253-306-3 | Product Categories: | organic compound;Biochemistry;Dioxanes & Dioxolanes;Dioxolanes;O-Substituted Sugars;Sugar Alcohols;Sugars | Mol File: | 37002-45-2.mol |  |
| (-)-1,4-DI-O-TOSYL-2,3-O-ISOPROPYLIDENETHREITOL Chemical Properties |
Melting point | 90-92 °C(lit.) | Boiling point | 542.03°C (rough estimate) | density | 1.3082 (rough estimate) | refractive index | 1.6000 (estimate) | storage temp. | Sealed in dry,2-8°C | solubility | DCM, Ethyl Acetate | form | Powder | color | white | Optical Rotation | [α]23/D 12.3°, c = 8.8 in chloroform | BRN | 99610 | Stability: | store cold | InChI | InChI=1/C21H26O8S2/c1-15-5-9-17(10-6-15)30(22,23)26-13-19-20(29-21(3,4)28-19)14-27-31(24,25)18-11-7-16(2)8-12-18/h5-12,19-20H,13-14H2,1-4H3/t19-,20-/s3 | InChIKey | KPFDKWNWYAXRNJ-XEBFJNFFNA-N | SMILES | [C@@H]1(COS(=O)(=O)C2C=CC(C)=CC=2)OC(C)(C)O[C@H]1COS(=O)(=O)C1C=CC(C)=CC=1 |&1:0,18,r| | CAS DataBase Reference | 37002-45-2(CAS DataBase Reference) |
Safety Statements | 24/25 | WGK Germany | 3 | HS Code | 2932.99.7000 |
| (-)-1,4-DI-O-TOSYL-2,3-O-ISOPROPYLIDENETHREITOL Usage And Synthesis |
Chemical Properties | white to cream crystalline powder | Uses | 1,4-Di-O-tosyl-2,3-O-isopropylidene-L-threitol has been used in coordination chemistry of (R,R)-DIPPOP. |
| (-)-1,4-DI-O-TOSYL-2,3-O-ISOPROPYLIDENETHREITOL Preparation Products And Raw materials |
|