|
|
| | Sulfolex-13C6 Basic information |
| | Sulfolex-13C6 Chemical Properties |
| Melting point | 255-256°C (dec.) | | storage temp. | -20°C Freezer | | solubility | DMSO (Slightly), Methanol (Very Slightly, Heated) | | color | White to Light Yellow | | Stability: | Light Sensitive | | Major Application | clinical testing | | InChI | 1S/C10H10N4O2S/c11-8-2-4-9(5-3-8)17(15,16)14-10-12-6-1-7-13-10/h1-7H,11H2,(H,12,13,14)/i2+1,3+1,4+1,5+1,8+1,9+1 | | InChIKey | SEEPANYCNGTZFQ-AHBHZWPESA-N | | SMILES | N[13c]1[13cH][13cH][13c]([13cH][13cH]1)S(=O)(=O)Nc2ncccn2 | | CAS DataBase Reference | 1189426-16-1 |
| Hazard Codes | Xn | | Risk Statements | 22-36/37/38-42/43 | | Safety Statements | 26-36 | | WGK Germany | 3 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Acute Tox. 4 Oral
Eye Irrit. 2
Resp. Sens. 1
Skin Irrit. 2
Skin Sens. 1
STOT SE 3 |
| | Sulfolex-13C6 Usage And Synthesis |
| Chemical Properties | Pale Yellow Solid | | Uses | Sulfolex-13C6 is intended for use as an internal standard for the quantification of Sulfadiazine by GC- or LC-mass spectrometry. | | Uses | The isotopically labelled drug Sulfadiazine. Antibacterial. | | IC 50 | Plasmodium; Toxoplasma |
| | Sulfolex-13C6 Preparation Products And Raw materials |
|