| Company Name: |
Sigma-Aldrich |
| Tel: |
021-61415566 800-8193336 |
| Email: |
orderCN@merckgroup.com |
DL-VALINE-2,3,4,4,4,5,5,5-D8 manufacturers
- DL-Valine-D8
-
-
2026-05-11
- CAS:203784-63-8
- Purity:
- Supply Ability: 10g
|
| | DL-VALINE-2,3,4,4,4,5,5,5-D8 Basic information |
| Product Name: | DL-VALINE-2,3,4,4,4,5,5,5-D8 | | Synonyms: | DL-VALINE-D8;DL-VALINE-2,3,4,4,4,5,5,5-D8, 98 ATOM % D;DL-Valine-d8 98 atom % D;DL-Valine-d?;DL-Valine-d8 in 0.1 M HCl;Molnupiravir Impurity 38;DL-Valine-d8;DL-Valine (D?, 98%) | | CAS: | 203784-63-8 | | MF: | C5H3D8NO2 | | MW: | 125.2 | | EINECS: | | | Product Categories: | Amino Acids 13C, 2H, 15N | | Mol File: | 203784-63-8.mol |  |
| | DL-VALINE-2,3,4,4,4,5,5,5-D8 Chemical Properties |
| Melting point | 295 °C (subl.)(lit.) | | Boiling point | 213.642±23.00 °C(Press: 760.00 Torr)(predicted) | | density | 1.064±0.06 g/cm3(Temp: 25 °C; Press: 760 Torr)(predicted) | | pka | 2.366±0.10(predicted) | | form | Solid | | color | White to off-white | | InChI | 1S/C5H11NO2/c1-3(2)4(6)5(7)8/h3-4H,6H2,1-2H3,(H,7,8)/i1D3,2D3,3D,4D | | InChIKey | KZSNJWFQEVHDMF-PIODKIDGSA-N | | SMILES | [2H]C([2H])([2H])C([2H])(C([2H])([2H])[2H])C([2H])(N)C(O)=O | | CAS Number Unlabeled | 516-06-3 |
| WGK Germany | 3 | | Storage Class | 11 - Combustible Solids |
| | DL-VALINE-2,3,4,4,4,5,5,5-D8 Usage And Synthesis |
| Uses | DL-Valine-d8 (CAS# 203784-63-8) is a useful isotopically labeled research compound. |
| | DL-VALINE-2,3,4,4,4,5,5,5-D8 Preparation Products And Raw materials |
|