| Company Name: |
J & K SCIENTIFIC LTD.
|
| Tel: |
18210857532 18210857532 |
| Email: |
jkinfo@jkchemical.com |
| Products Intro: |
Product Name:rac Toltrazuril Sulfoxide CAS:69004-15-5 Package:250Mg,25Mg
|
| Company Name: |
Chemsky (shanghai) International Co.,Ltd
|
| Tel: |
021-50135380 |
| Email: |
shchemsky@sina.com |
| Products Intro: |
Product Name:rac Toltrazuril Sulfoxide CAS:69004-15-5 Purity:98+% Package:1Mg;5Mg;10Mg;50Mg;100Mg;500Mg
|
| Company Name: |
Sichuan Kulinan Technology Co., Ltd
|
| Tel: |
400-1166-196 18981987031 |
| Email: |
cdhxsj@163.com |
| Products Intro: |
Product Name:1-Methyl-3-{3-methyl-4-4-(trifluormethylsulfinyl)-phenoxy-phenyl}-1,3,5-triazin-2,4,6(1H,3H,5H)-trion CAS:69004-15-5 Purity:99% HPLC Package:10g;50g;100g;500g;1kg;5kg;25kg
|
|
| | 1-Methyl-3-{3-methyl-4-[4-(trifluormethylsulfinyl)-phenoxy]-phenyl}-1,3,5-triazin-2,4,6(1H,3H,5H)-trion Basic information |
| Product Name: | 1-Methyl-3-{3-methyl-4-[4-(trifluormethylsulfinyl)-phenoxy]-phenyl}-1,3,5-triazin-2,4,6(1H,3H,5H)-trion | | Synonyms: | 1-Methyl-3-{3-methyl-4-[4-(trifluormethylsulfinyl)-phenoxy]-phenyl}-1,3,5-triazin-2,4,6(1H,3H,5H)-trion;Toltrazuril sulfoxide;rac Toltrazuril Sulfoxide;Toltrazuril Sulfoxide Standard;1,3,5-Triazine-2,4,6(1H,3H,5H)-trione, 1-methyl-3-[3-methyl-4-[4-[(trifluoromethyl)sulfinyl]phenoxy]phenyl]-;Toltrazuril Sulfoxide in Methanol;C17592040 Toltrazuril-sulfoxide;Alitretinoin Impurity 17 | | CAS: | 69004-15-5 | | MF: | C18H14F3N3O5S | | MW: | 441.38 | | EINECS: | | | Product Categories: | Intermediates & Fine Chemicals;Metabolites & Impurities;Pharmaceuticals | | Mol File: | 69004-15-5.mol | ![1-Methyl-3-{3-methyl-4-[4-(trifluormethylsulfinyl)-phenoxy]-phenyl}-1,3,5-triazin-2,4,6(1H,3H,5H)-trion Structure](CAS/GIF/69004-15-5.gif) |
| | 1-Methyl-3-{3-methyl-4-[4-(trifluormethylsulfinyl)-phenoxy]-phenyl}-1,3,5-triazin-2,4,6(1H,3H,5H)-trion Chemical Properties |
| Melting point | >212°C (dec.) | | storage temp. | -20°C Freezer | | solubility | Chloroform (Slightly), Methanol (Slightly), Water (Slightly) | | form | Solid | | color | White to Off-White | | Major Application | forensics and toxicology pharmaceutical (small molecule) veterinary | | InChI | 1S/C18H14F3N3O5S/c1-10-9-11(24-16(26)22-15(25)23(2)17(24)27)3-8-14(10)29-12-4-6-13(7-5-12)30(28)18(19,20)21/h3-9H,1-2H3,(H,22,25,26) | | InChIKey | QWKYIPKCLAUFCM-UHFFFAOYSA-N | | SMILES | CN1C(=O)NC(=O)N(C1=O)c2ccc(Oc3ccc(cc3)S(=O)C(F)(F)F)c(C)c2 |
| WGK Germany | 3 | | Storage Class | 11 - Combustible Solids |
| | 1-Methyl-3-{3-methyl-4-[4-(trifluormethylsulfinyl)-phenoxy]-phenyl}-1,3,5-triazin-2,4,6(1H,3H,5H)-trion Usage And Synthesis |
| Uses | Toltrazuril metabolite. | | IC 50 | Coccidia |
| | 1-Methyl-3-{3-methyl-4-[4-(trifluormethylsulfinyl)-phenoxy]-phenyl}-1,3,5-triazin-2,4,6(1H,3H,5H)-trion Preparation Products And Raw materials |
|