| Company Name: |
Energy Chemical |
| Tel: |
400-0056266 |
| Email: |
sales8178@energy-chemical.com |
- L-Fructose
-
-
2026-09-11
- CAS:7776-48-9
- Min. Order: 10G
- Purity: 98%min
- Supply Ability: 30kg/month
- L-Fructose
-
- $3.00
-
2020-01-13
- CAS:7776-48-9
- Min. Order: 1KG
- Purity: 98%
- Supply Ability: 200KG
|
| | L-Fructose Basic information |
| | L-Fructose Chemical Properties |
| Melting point | 101-103 °C | | Boiling point | 551.7±50.0 °C(Predicted) | | density | 1.589±0.06 g/cm3(Predicted) | | storage temp. | Refrigerator | | solubility | DMSO (Slightly), Water | | form | Clear Colourless Solution | | pka | 11.86±0.20(Predicted) | | color | White to Almost white | | BRN | 1724560 | | InChI | 1S/C6H12O6/c7-1-3(9)5(11)6(12)4(10)2-8/h3,5-9,11-12H,1-2H2/t3-,5-,6-/m0/s1 | | InChIKey | BJHIKXHVCXFQLS-FUTKDDECSA-N | | SMILES | OC[C@H](O)[C@H](O)[C@@H](O)C(=O)CO | | CAS DataBase Reference | 7776-48-9(CAS DataBase Reference) |
| Safety Statements | 24/25 | | WGK Germany | 3 | | F | 3 | | HS Code | 17025000 | | Storage Class | 11 - Combustible Solids |
| | L-Fructose Usage And Synthesis |
| Chemical Properties | White to off-white crystalline powder | | Uses | L-Fructose is the L-isomer of D-Fructose (F792500), a monosaccharide found in number of fruits and plants. | | Definition | ChEBI: The L-enantiomer of fructofuranose. |
| | L-Fructose Preparation Products And Raw materials |
|