| Company Name: |
Alfa Aesar |
| Tel: |
400-6106006 |
| Email: |
saleschina@alfa-asia.com |
| Company Name: |
Energy Chemical |
| Tel: |
400-0056266 |
| Email: |
sales8178@energy-chemical.com |
|
| | (R)-(+)-3-(Benzyloxycarbonyl)-4-oxazolidinecarboxylic acid Basic information |
| | (R)-(+)-3-(Benzyloxycarbonyl)-4-oxazolidinecarboxylic acid Chemical Properties |
| Melting point | 70-74 °C(lit.) | | alpha | +92°(20℃, c=1, CHCl3) | | Boiling point | 454.8±45.0 °C(Predicted) | | density | 1.385 | | pka | 3.51±0.20(Predicted) | | form | solid | | Optical Rotation | [α]20/D +92°, c = 1 in chloroform | | InChI | InChI=1S/C12H13NO5/c14-11(15)10-7-17-8-13(10)12(16)18-6-9-4-2-1-3-5-9/h1-5,10H,6-8H2,(H,14,15)/t10-/m1/s1 | | InChIKey | XRRRGBIMHQARMF-SNVBAGLBSA-N | | SMILES | O1C[C@H](C(O)=O)N(C(OCC2=CC=CC=C2)=O)C1 | | CAS DataBase Reference | 97534-84-4 |
| WGK Germany | 3 | | HS Code | 29349990 | | Storage Class | 11 - Combustible Solids |
| | (R)-(+)-3-(Benzyloxycarbonyl)-4-oxazolidinecarboxylic acid Usage And Synthesis |
| Chemical Properties | White powder | | Uses | Useful chiral synthon (derived from serine) for the asymmetric synthesis of a variety of nitrogen-containing targets. |
| | (R)-(+)-3-(Benzyloxycarbonyl)-4-oxazolidinecarboxylic acid Preparation Products And Raw materials |
|