| Company Name: |
Energy Chemical |
| Tel: |
400-0056266 |
| Email: |
sales8178@energy-chemical.com |
| Company Name: |
Sigma-Aldrich |
| Tel: |
021-61415566 800-8193336 |
| Email: |
orderCN@merckgroup.com |
|
| | H-Val-allyl ester p-tosylate Basic information |
| | H-Val-allyl ester p-tosylate Chemical Properties |
| Melting point | 117-120 °C | | storage temp. | 2-8°C | | form | crystals | | Optical Rotation | [α]20/D +5.5±1°, c = 1% in methanol | | BRN | 5200860 | | Major Application | peptide synthesis | | InChI | 1S/C8H15NO2.C7H8O3S/c1-4-5-11-8(10)7(9)6(2)3;1-6-2-4-7(5-3-6)11(8,9)10/h4,6-7H,1,5,9H2,2-3H3;2-5H,1H3,(H,8,9,10)/t7-;/m0./s1 | | InChIKey | HSIRKDASFUCGOZ-FJXQXJEOSA-N | | SMILES | CC(C)[C@H]([NH3+])C(=O)OCC=C.Cc1ccc(cc1)S([O-])(=O)=O |
| Safety Statements | 22-24/25 | | WGK Germany | 3 | | F | 8-10 | | Storage Class | 13 - Non Combustible Solids |
| | H-Val-allyl ester p-tosylate Usage And Synthesis |
| Chemical Properties | White powder | | Uses | peptide synthesis | | reaction suitability | reaction type: solution phase peptide synthesis |
| | H-Val-allyl ester p-tosylate Preparation Products And Raw materials |
|