- Protosappanin B
-
- $195.00
-
2026-07-16
- CAS:102036-29-3
- Purity: 98.51%
- Supply Ability: 10g
- Protosappanin B
-
-
2023-02-24
- CAS:102036-29-3
- Min. Order: 5mg
- Purity: ≥98%(HPLC)
- Supply Ability: 10 g
|
| | (7S)-3,7,10,11-Tetrahydroxy-7,8-dihydro-6H-dibenzo[b,d]oxocin-7-methanol Basic information |
| Product Name: | (7S)-3,7,10,11-Tetrahydroxy-7,8-dihydro-6H-dibenzo[b,d]oxocin-7-methanol | | Synonyms: | (7S)-3,7,10,11-Tetrahydroxy-7,8-dihydro-6H-dibenzo[b,d]oxocin-7-methanol;(7S,12aS)-7,8-Dihydro-7-(hydroxymethyl)-6H-dibenz[b,d]oxocin-3,7,10,11-tetrol;6H-Dibenz[b,d]oxocin-3,7,10,11-tetrol,7,8-dihydro-7-(hydroxymethyl)-, (7S,12aS)-;FT-0689654;Q-100961;6H-Dibenz[b,d]oxocin-3,7,10,11-tetrol,7,8-dihydro-7-(hydroxy...;Protosappanin B-RM;Protosappanin B, 10 mM in DMSO | | CAS: | 102036-29-3 | | MF: | C16H16O6 | | MW: | 304.3 | | EINECS: | | | Product Categories: | chemical reagent;pharmaceutical intermediate;phytochemical;reference standards from Chinese medicinal herbs (TCM).;standardized herbal extract | | Mol File: | 102036-29-3.mol | ![(7S)-3,7,10,11-Tetrahydroxy-7,8-dihydro-6H-dibenzo[b,d]oxocin-7-methanol Structure](CAS/GIF/102036-29-3.gif) |
| | (7S)-3,7,10,11-Tetrahydroxy-7,8-dihydro-6H-dibenzo[b,d]oxocin-7-methanol Chemical Properties |
| Boiling point | 655.5±55.0 °C(Predicted) | | density | 1.507 | | storage temp. | 2-8°C | | pka | 9.20±0.40(Predicted) | | form | Solid | | color | Light yellow to orange | | InChI | 1S/C16H16O6/c17-7-16(21)6-9-3-13(19)14(20)5-12(9)11-2-1-10(18)4-15(11)22-8-16/h1-5,17-21H,6-8H2 | | InChIKey | QRTYTQTVJQUCEP-UHFFFAOYSA-N | | SMILES | O1CC(Cc2c(cc(c(c2)O)O)c3c1cc(cc3)O)(O)CO |
| WGK Germany | WGK 3 | | Storage Class | 11 - Combustible Solids |
| | (7S)-3,7,10,11-Tetrahydroxy-7,8-dihydro-6H-dibenzo[b,d]oxocin-7-methanol Usage And Synthesis |
| Description | Research results in recent years have shown that sumac extract has a significant inhibitory effect on a variety of tumor cells. Protosappanin B is one of the main components in hematoxylin. It has inhibitory effect on the proliferation of both BTT and T24 cells, and as Protosappanin B acts on each cell for a longer period of time, its killing effect is gradually enhanced, showing a time-dependence. | | Chemical Properties | Soluble in methanol, DMSO, insoluble in petroleum ether and other solvents. | | Uses | Used for content determination/identification/pharmacological experiments, etc. | | Biological Activity | Protosappanin B is a polyphenol extracted from hematoxylin and has anti-tumor effects. In human bladder cancer cells, it can arrest the G1 phase of the cell cycle and induce apoptosis. | | target | |
| | (7S)-3,7,10,11-Tetrahydroxy-7,8-dihydro-6H-dibenzo[b,d]oxocin-7-methanol Preparation Products And Raw materials |
|